EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | (C6H12NO6P)n.H2O |
| Net Charge | 0 |
| Average Mass | 243.152 |
| Monoisotopic Mass | 243.05079 |
| SMILES | [H]OC[C@@H](COP(=O)(O)O)OC(=O)C(C)N |
| InChI | InChI=1S/C6H14NO7P/c1-4(7)6(9)14-5(2-8)3-13-15(10,11)12/h4-5,8H,2-3,7H2,1H3,(H2,10,11,12)/t4?,5-/m0/s1 |
| InChIKey | JPCGABBYVSDYMQ-AKGZTFGVSA-N |
| Roles Classification |
|---|
| Biological Role: | bacterial metabolite Any prokaryotic metabolite produced during a metabolic reaction in bacteria. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| alanyl poly(glycerol phosphate)s (CHEBI:15338) is a aminoacyl phosphate (CHEBI:36951) |
| alanyl poly(glycerol phosphate)s (CHEBI:15338) is a poly(glycerol phosphate) macromolecule (CHEBI:15943) |
| alanyl poly(glycerol phosphate)s (CHEBI:15338) is conjugate acid of alanyl poly(glycerol phosphate)(1−) (CHEBI:60100) |
| Incoming Relation(s) |
| D-alanyl-L-alanyl poly(glycerol phosphate) (CHEBI:15798) is a alanyl poly(glycerol phosphate)s (CHEBI:15338) |
| alanyl poly(glycerol phosphate)(1−) (CHEBI:60100) is conjugate base of alanyl poly(glycerol phosphate)s (CHEBI:15338) |
| Synonyms | Source |
|---|---|
| Alanyl-poly(glycerolphosphate) | KEGG COMPOUND |
| (D-Ala1->2Gro-1-P)n | KEGG COMPOUND |
| Manual Xrefs | Databases |
|---|---|
| C03999 | KEGG COMPOUND |