EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | (C6H12NO6P)n.HO |
| Net Charge | -1 |
| Average Mass | 242.144 |
| Monoisotopic Mass | 242.04351 |
| SMILES | [H]OC[C@@H](COP(=O)([O-])[O-])OC(=O)C(C)[NH3+] |
| InChI | InChI=1S/C6H14NO7P/c1-4(7)6(9)14-5(2-8)3-13-15(10,11)12/h4-5,8H,2-3,7H2,1H3,(H2,10,11,12)/p-1/t4?,5-/m0/s1 |
| InChIKey | JPCGABBYVSDYMQ-AKGZTFGVSA-M |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| alanyl poly(glycerol phosphate)(1−) (CHEBI:60100) is a organophosphate oxoanion (CHEBI:58945) |
| alanyl poly(glycerol phosphate)(1−) (CHEBI:60100) is conjugate base of alanyl poly(glycerol phosphate)s (CHEBI:15338) |
| Incoming Relation(s) |
| alanyl poly(glycerol phosphate)s (CHEBI:15338) is conjugate acid of alanyl poly(glycerol phosphate)(1−) (CHEBI:60100) |
| Synonyms | Source |
|---|---|
| alanyl poly(glycerol phosphate) anions | ChEBI |
| alanyl poly(glycerol phosphate) anion | ChEBI |
| UniProt Name | Source |
|---|---|
| alanyl poly(glycerol phosphate) | UniProt |