EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | (C9H17N2O7P)n.H2O |
| Net Charge | 0 |
| Average Mass | 314.231 |
| Monoisotopic Mass | 314.08790 |
| SMILES | [H]OC[C@@H](COP(=O)(O)O)OC(=O)[C@@H](C)NC(=O)[C@@H](C)N |
| InChI | InChI=1S/C9H19N2O8P/c1-5(10)8(13)11-6(2)9(14)19-7(3-12)4-18-20(15,16)17/h5-7,12H,3-4,10H2,1-2H3,(H,11,13)(H2,15,16,17)/t5-,6-,7+/m1/s1 |
| InChIKey | BOLRFGHAQSWKGO-QYNIQEEDSA-N |
| Roles Classification |
|---|
| Biological Role: | bacterial metabolite Any prokaryotic metabolite produced during a metabolic reaction in bacteria. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| D-alanyl-L-alanyl poly(glycerol phosphate) (CHEBI:15798) is a alanyl poly(glycerol phosphate)s (CHEBI:15338) |
| D-alanyl-L-alanyl poly(glycerol phosphate) (CHEBI:15798) is conjugate acid of D-alanyl-L-alanyl poly(glycerol phosphate)(1−) (CHEBI:57517) |
| Incoming Relation(s) |
| D-alanyl-L-alanyl poly(glycerol phosphate)(1−) (CHEBI:57517) is conjugate base of D-alanyl-L-alanyl poly(glycerol phosphate) (CHEBI:15798) |
| Synonym | Source |
|---|---|
| D-Alanyl-alanyl-poly(glycerolphosphate) | KEGG COMPOUND |
| Manual Xrefs | Databases |
|---|---|
| C04457 | KEGG COMPOUND |