EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C34H32FeN4O4 |
| Net Charge | 0 |
| Average Mass | 616.499 |
| Monoisotopic Mass | 616.17729 |
| SMILES | C=CC1=C(C)C2=Cc3c(C=C)c(C)c4[n]3[Fe-2]35[n]6c(c(C)c(CCC(=O)O)c6=CC6=[N+]3C(=C4)C(C)=C6CCC(=O)O)=CC1=[N+]25 |
| InChI | InChI=1S/C34H34N4O4.Fe/c1-7-21-17(3)25-13-26-19(5)23(9-11-33(39)40)31(37-26)16-32-24(10-12-34(41)42)20(6)28(38-32)15-30-22(8-2)18(4)27(36-30)14-29(21)35-25;/h7-8,13-16H,1-2,9-12H2,3-6H3,(H4,35,36,37,38,39,40,41,42);/q;+2/p-2/b25-13-,26-13-,27-14-,28-15-,29-14-,30-15-,31-16-,32-16-; |
| InChIKey | KABFMIBPWCXCRK-RGGAHWMASA-L |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Homo sapiens (ncbitaxon:9606) | - | DOI (10.1038/nbt.2488) |
| Roles Classification |
|---|
| Biological Roles: | human metabolite Any mammalian metabolite produced during a metabolic reaction in humans (Homo sapiens). cofactor An organic molecule or ion (usually a metal ion) that is required by an enzyme for its activity. It may be attached either loosely (coenzyme) or tightly (prosthetic group). metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. prosthetic group A tightly bound, specific nonpolypeptide unit in a protein determining and involved in its biological activity. cofactor An organic molecule or ion (usually a metal ion) that is required by an enzyme for its activity. It may be attached either loosely (coenzyme) or tightly (prosthetic group). cofactor An organic molecule or ion (usually a metal ion) that is required by an enzyme for its activity. It may be attached either loosely (coenzyme) or tightly (prosthetic group). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| ferroheme b (CHEBI:17627) has role cofactor (CHEBI:23357) |
| ferroheme b (CHEBI:17627) has role human metabolite (CHEBI:77746) |
| ferroheme b (CHEBI:17627) is a ferroheme (CHEBI:38573) |
| ferroheme b (CHEBI:17627) is a heme b (CHEBI:26355) |
| ferroheme b (CHEBI:17627) is conjugate acid of ferroheme b(2−) (CHEBI:60344) |
| Incoming Relation(s) |
| heme d cis-diol (CHEBI:62811) has functional parent ferroheme b (CHEBI:17627) |
| heme d trans-diol (CHEBI:62812) has functional parent ferroheme b (CHEBI:17627) |
| ferrocytochrome b (CHEBI:5034) has part ferroheme b (CHEBI:17627) |
| ferroheme b(2−) (CHEBI:60344) is conjugate base of ferroheme b (CHEBI:17627) |
| IUPAC Name |
|---|
| (protoporphyrinato)iron(II) |
| Synonyms | Source |
|---|---|
| [3,7,12,17-tetramethyl-8,13-divinylporphyrin-2,18-dipropanoato(2−)]iron(II) | IUPAC |
| Fe(II) heme b | ChEBI |
| Fe(II)-heme b | ChEBI |
| [Fe(ppIX)] | IUPAC |
| Fe(ppIX) | ChEBI |
| ferroprotoheme | ChEBI |
| Registry Numbers | Sources |
|---|---|
| Gmelin:95291 | Gmelin |
| Beilstein:953574 | Beilstein |
| CAS:14875-96-8 | KEGG COMPOUND |
| CAS:14875-96-8 | ChemIDplus |
| Citations |
|---|