EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C15H22NO2 |
| Net Charge | +1 |
| Average Mass | 248.346 |
| Monoisotopic Mass | 248.16451 |
| SMILES | CCOC(=O)C1(c2ccccc2)CC[NH+](C)CC1 |
| InChI | InChI=1S/C15H21NO2/c1-3-18-14(17)15(9-11-16(2)12-10-15)13-7-5-4-6-8-13/h4-8H,3,9-12H2,1-2H3/p+1 |
| InChIKey | XADCESSVHJOZHK-UHFFFAOYSA-O |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| pethidine(1+) (CHEBI:149471) is a ammonium ion derivative (CHEBI:35274) |
| pethidine(1+) (CHEBI:149471) is conjugate acid of pethidine (CHEBI:6754) |
| Incoming Relation(s) |
| pethidine hydrochloride (CHEBI:31984) has part pethidine(1+) (CHEBI:149471) |
| pethidine (CHEBI:6754) is conjugate base of pethidine(1+) (CHEBI:149471) |
| IUPAC Name |
|---|
| 4-(ethoxycarbonyl)-1-methyl-4-phenylpiperidinium |
| Synonym | Source |
|---|---|
| 4-(ethoxycarbonyl)-1-methyl-4-phenylpiperidin-1-ium | IUPAC |