EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
CHEBI:31984 - pethidine hydrochloride
| Formula | C15H21NO2.HCl |
| Net Charge | 0 |
| Average Mass | 283.799 |
| Monoisotopic Mass | 283.13391 |
| SMILES | CCOC(=O)C1(c2ccccc2)CCN(C)CC1.Cl |
| InChI | InChI=1S/C15H21NO2.ClH/c1-3-18-14(17)15(9-11-16(2)12-10-15)13-7-5-4-6-8-13;/h4-8H,3,9-12H2,1-2H3;1H |
| InChIKey | WCNLCIJMFAJCPX-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Biological Roles: | kappa-opioid receptor agonist A compound that exhibits agonist activity at the κ-opioid receptor. opioid analgesic A narcotic or opioid substance, synthetic or semisynthetic agent producing profound analgesia, drowsiness, and changes in mood. mu-opioid receptor agonist A compound that exhibits agonist activity at the μ-opioid receptor. |
| Applications: | antispasmodic drug A drug that suppresses spasms. These are usually caused by smooth muscle contraction, especially in tubular organs. The effect is to prevent spasms of the stomach, intestine or urinary bladder. kappa-opioid receptor agonist A compound that exhibits agonist activity at the κ-opioid receptor. opioid analgesic A narcotic or opioid substance, synthetic or semisynthetic agent producing profound analgesia, drowsiness, and changes in mood. mu-opioid receptor agonist A compound that exhibits agonist activity at the μ-opioid receptor. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| pethidine hydrochloride (CHEBI:31984) has part pethidine(1+) (CHEBI:149471) |
| pethidine hydrochloride (CHEBI:31984) has role antispasmodic drug (CHEBI:53784) |
| pethidine hydrochloride (CHEBI:31984) has role opioid analgesic (CHEBI:35482) |
| pethidine hydrochloride (CHEBI:31984) has role κ-opioid receptor agonist (CHEBI:59282) |
| pethidine hydrochloride (CHEBI:31984) has role μ-opioid receptor agonist (CHEBI:55322) |
| pethidine hydrochloride (CHEBI:31984) is a hydrochloride (CHEBI:36807) |
| IUPAC Name |
|---|
| ethyl 1-methyl-4-phenylpiperidine-4-carboxylate hydrochloride |
| Synonyms | Source |
|---|---|
| 1-methyl-4-carbethoxy-4-phenylpiperidine hydrochloride | ChemIDplus |
| 1-methyl-4-phenyl-4-carboethoxypiperidine hydrochloride | ChemIDplus |
| 1-methyl-4-phenylisonipecotic acid ethyl ester hydrochloride | ChemIDplus |
| 4-(ethoxycarbonyl)-1-methyl-4-phenylpiperidinium chloride | IUPAC |
| N-methyl-4-phenyl-4-carbethoxypiperidine hydrochloride | ChemIDplus |
| ethyl 1-methyl-4-phenylisonipecotate hydrochloride | ChemIDplus |
| Brand Names | Source |
|---|---|
| Algil | ChemIDplus |
| Alodan | ChemIDplus |
| Antiduol | ChemIDplus |
| Antidurol | ChemIDplus |
| Centralgin | ChemIDplus |
| Chlorbicyclene | ChemIDplus |
| Citations |
|---|