EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C15H21NO2.HCl |
| Net Charge | 0 |
| Average Mass | 283.799 |
| Monoisotopic Mass | 283.13391 |
| SMILES | CCOC(=O)C1(c2ccccc2)CCN(C)CC1.Cl |
| InChI | InChI=1S/C15H21NO2.ClH/c1-3-18-14(17)15(9-11-16(2)12-10-15)13-7-5-4-6-8-13;/h4-8H,3,9-12H2,1-2H3;1H |
| InChIKey | WCNLCIJMFAJCPX-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Biological Roles: | opioid analgesic A narcotic or opioid substance, synthetic or semisynthetic agent producing profound analgesia, drowsiness, and changes in mood. kappa-opioid receptor agonist A compound that exhibits agonist activity at the κ-opioid receptor. mu-opioid receptor agonist A compound that exhibits agonist activity at the μ-opioid receptor. |
| Applications: | antispasmodic drug A drug that suppresses spasms. These are usually caused by smooth muscle contraction, especially in tubular organs. The effect is to prevent spasms of the stomach, intestine or urinary bladder. opioid analgesic A narcotic or opioid substance, synthetic or semisynthetic agent producing profound analgesia, drowsiness, and changes in mood. kappa-opioid receptor agonist A compound that exhibits agonist activity at the κ-opioid receptor. mu-opioid receptor agonist A compound that exhibits agonist activity at the μ-opioid receptor. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| pethidine hydrochloride (CHEBI:31984) has part pethidine(1+) (CHEBI:149471) |
| pethidine hydrochloride (CHEBI:31984) has role antispasmodic drug (CHEBI:53784) |
| pethidine hydrochloride (CHEBI:31984) has role opioid analgesic (CHEBI:35482) |
| pethidine hydrochloride (CHEBI:31984) has role κ-opioid receptor agonist (CHEBI:59282) |
| pethidine hydrochloride (CHEBI:31984) has role μ-opioid receptor agonist (CHEBI:55322) |
| pethidine hydrochloride (CHEBI:31984) is a hydrochloride (CHEBI:36807) |
| IUPAC Name |
|---|
| ethyl 1-methyl-4-phenylpiperidine-4-carboxylate hydrochloride |
| Synonyms | Source |
|---|---|
| 1-methyl-4-carbethoxy-4-phenylpiperidine hydrochloride | ChemIDplus |
| 1-methyl-4-phenyl-4-carboethoxypiperidine hydrochloride | ChemIDplus |
| 1-methyl-4-phenylisonipecotic acid ethyl ester hydrochloride | ChemIDplus |
| 4-(ethoxycarbonyl)-1-methyl-4-phenylpiperidinium chloride | IUPAC |
| N-methyl-4-phenyl-4-carbethoxypiperidine hydrochloride | ChemIDplus |
| ethyl 1-methyl-4-phenylisonipecotate hydrochloride | ChemIDplus |
| Brand Names | Source |
|---|---|
| Algil | ChemIDplus |
| Alodan | ChemIDplus |
| Antiduol | ChemIDplus |
| Antidurol | ChemIDplus |
| Centralgin | ChemIDplus |
| Chlorbicyclene | ChemIDplus |
| Citations |
|---|