EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C15H21NO2 |
| Net Charge | 0 |
| Average Mass | 247.338 |
| Monoisotopic Mass | 247.15723 |
| SMILES | CCOC(=O)C1(c2ccccc2)CCN(C)CC1 |
| InChI | InChI=1S/C15H21NO2/c1-3-18-14(17)15(9-11-16(2)12-10-15)13-7-5-4-6-8-13/h4-8H,3,9-12H2,1-2H3 |
| InChIKey | XADCESSVHJOZHK-UHFFFAOYSA-N |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| Biological Roles: | opioid analgesic A narcotic or opioid substance, synthetic or semisynthetic agent producing profound analgesia, drowsiness, and changes in mood. kappa-opioid receptor agonist A compound that exhibits agonist activity at the κ-opioid receptor. mu-opioid receptor agonist A compound that exhibits agonist activity at the μ-opioid receptor. |
| Applications: | antispasmodic drug A drug that suppresses spasms. These are usually caused by smooth muscle contraction, especially in tubular organs. The effect is to prevent spasms of the stomach, intestine or urinary bladder. opioid analgesic A narcotic or opioid substance, synthetic or semisynthetic agent producing profound analgesia, drowsiness, and changes in mood. kappa-opioid receptor agonist A compound that exhibits agonist activity at the κ-opioid receptor. mu-opioid receptor agonist A compound that exhibits agonist activity at the μ-opioid receptor. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| pethidine (CHEBI:6754) has role antispasmodic drug (CHEBI:53784) |
| pethidine (CHEBI:6754) has role opioid analgesic (CHEBI:35482) |
| pethidine (CHEBI:6754) has role κ-opioid receptor agonist (CHEBI:59282) |
| pethidine (CHEBI:6754) has role μ-opioid receptor agonist (CHEBI:55322) |
| pethidine (CHEBI:6754) is a ethyl ester (CHEBI:23990) |
| pethidine (CHEBI:6754) is a piperidinecarboxylate ester (CHEBI:48630) |
| pethidine (CHEBI:6754) is a tertiary amino compound (CHEBI:50996) |
| pethidine (CHEBI:6754) is conjugate base of pethidine(1+) (CHEBI:149471) |
| Incoming Relation(s) |
| pethidine(1+) (CHEBI:149471) is conjugate acid of pethidine (CHEBI:6754) |
| IUPAC Name |
|---|
| ethyl 1-methyl-4-phenylpiperidine-4-carboxylate |
| INNs | Source |
|---|---|
| pethidine | WHO MedNet |
| péthidine | WHO MedNet |
| pethidinum | WHO MedNet |
| petidina | WHO MedNet |
| Synonyms | Source |
|---|---|
| 1-methyl-4-phenyl-4-piperidinecarboxylic acid ethyl ester | ChEBI |
| 1-methyl-4-phenylisonipecotic acid ethyl ester | ChemIDplus |
| 1-methyl-4-phenylpiperidine-4-carboxylic acid ethyl ester | ChemIDplus |
| N-methyl-4-phenyl-4-carbethoxypiperidine | ChemIDplus |
| ethyl 1-methyl-4-phenylisonipecotate | ChemIDplus |
| IDS-NP-001 | DrugBank |
| Brand Names | Source |
|---|---|
| Demerol | ChemIDplus |
| Meperidol | ChemIDplus |
| Nemerol | ChemIDplus |
| Pethanol | ChemIDplus |
| Citations |
|---|