EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C15H21NO2 |
| Net Charge | 0 |
| Average Mass | 247.338 |
| Monoisotopic Mass | 247.15723 |
| SMILES | CCOC(=O)C1(c2ccccc2)CCN(C)CC1 |
| InChI | InChI=1S/C15H21NO2/c1-3-18-14(17)15(9-11-16(2)12-10-15)13-7-5-4-6-8-13/h4-8H,3,9-12H2,1-2H3 |
| InChIKey | XADCESSVHJOZHK-UHFFFAOYSA-N |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| Biological Roles: | mu-opioid receptor agonist A compound that exhibits agonist activity at the μ-opioid receptor. kappa-opioid receptor agonist A compound that exhibits agonist activity at the κ-opioid receptor. opioid analgesic A narcotic or opioid substance, synthetic or semisynthetic agent producing profound analgesia, drowsiness, and changes in mood. |
| Applications: | mu-opioid receptor agonist A compound that exhibits agonist activity at the μ-opioid receptor. kappa-opioid receptor agonist A compound that exhibits agonist activity at the κ-opioid receptor. opioid analgesic A narcotic or opioid substance, synthetic or semisynthetic agent producing profound analgesia, drowsiness, and changes in mood. antispasmodic drug A drug that suppresses spasms. These are usually caused by smooth muscle contraction, especially in tubular organs. The effect is to prevent spasms of the stomach, intestine or urinary bladder. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| pethidine (CHEBI:6754) has role antispasmodic drug (CHEBI:53784) |
| pethidine (CHEBI:6754) has role opioid analgesic (CHEBI:35482) |
| pethidine (CHEBI:6754) has role κ-opioid receptor agonist (CHEBI:59282) |
| pethidine (CHEBI:6754) has role μ-opioid receptor agonist (CHEBI:55322) |
| pethidine (CHEBI:6754) is a ethyl ester (CHEBI:23990) |
| pethidine (CHEBI:6754) is a piperidinecarboxylate ester (CHEBI:48630) |
| pethidine (CHEBI:6754) is a tertiary amino compound (CHEBI:50996) |
| pethidine (CHEBI:6754) is conjugate base of pethidine(1+) (CHEBI:149471) |
| Incoming Relation(s) |
| pethidine(1+) (CHEBI:149471) is conjugate acid of pethidine (CHEBI:6754) |
| IUPAC Name |
|---|
| ethyl 1-methyl-4-phenylpiperidine-4-carboxylate |
| INNs | Source |
|---|---|
| pethidine | WHO MedNet |
| petidina | WHO MedNet |
| péthidine | WHO MedNet |
| pethidinum | WHO MedNet |
| Synonyms | Source |
|---|---|
| meperidine | KEGG COMPOUND |
| 1-methyl-4-phenyl-4-piperidinecarboxylic acid ethyl ester | ChEBI |
| pethidineter | ChemIDplus |
| isonipecaine | DrugCentral |
| 1-methyl-4-phenylisonipecotic acid ethyl ester | ChemIDplus |
| petydyna | ChemIDplus |
| Brand Names | Source |
|---|---|
| Meperidol | ChemIDplus |
| Demerol | ChemIDplus |
| Nemerol | ChemIDplus |
| Pethanol | ChemIDplus |
| Citations |
|---|