EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C25H36N2O3 |
| Net Charge | +2 |
| Average Mass | 412.574 |
| Monoisotopic Mass | 412.27150 |
| SMILES | CC[NH+](CC)CCOc1ccc2c(c1)C(=O)c1cc(OCC[NH+](CC)CC)ccc1-2 |
| InChI | InChI=1S/C25H34N2O3/c1-5-26(6-2)13-15-29-19-9-11-21-22-12-10-20(30-16-14-27(7-3)8-4)18-24(22)25(28)23(21)17-19/h9-12,17-18H,5-8,13-16H2,1-4H3/p+2 |
| InChIKey | MPMFCABZENCRHV-UHFFFAOYSA-P |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| tilorone(2+) (CHEBI:147355) is a ammonium ion derivative (CHEBI:35274) |
| tilorone(2+) (CHEBI:147355) is conjugate acid of tilorone (CHEBI:147347) |
| Incoming Relation(s) |
| tilorone dihydrochloride (CHEBI:147356) has part tilorone(2+) (CHEBI:147355) |
| tilorone (CHEBI:147347) is conjugate base of tilorone(2+) (CHEBI:147355) |
| IUPAC Name |
|---|
| 2,2'-[(9-oxo-9H-fluorene-2,7-diyl)bis(oxy)]bis(N,N-diethylethanaminium) |
| Synonym | Source |
|---|---|
| N,N'-[(9-oxo-9H-fluorene-2,7-diyl)bis(oxyethane-2,1-diyl)]bis(N-ethylethan-1-aminium) | IUPAC |