EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C25H34N2O3 |
| Net Charge | 0 |
| Average Mass | 410.558 |
| Monoisotopic Mass | 410.25694 |
| SMILES | CCN(CC)CCOc1ccc2c(c1)C(=O)c1cc(OCCN(CC)CC)ccc1-2 |
| InChI | InChI=1S/C25H34N2O3/c1-5-26(6-2)13-15-29-19-9-11-21-22-12-10-20(30-16-14-27(7-3)8-4)18-24(22)25(28)23(21)17-19/h9-12,17-18H,5-8,13-16H2,1-4H3 |
| InChIKey | MPMFCABZENCRHV-UHFFFAOYSA-N |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| Biological Roles: | nicotinic acetylcholine receptor agonist An agonist that selectively binds to and activates a nicotinic acetylcholine receptor. EC 3.1.1.7 (acetylcholinesterase) inhibitor An EC 3.1.1.* (carboxylic ester hydrolase) inhibitor that interferes with the action of enzyme acetylcholinesterase (EC 3.1.1.7), which helps breaking down of acetylcholine into choline and acetic acid. antiviral agent A substance that destroys or inhibits replication of viruses. xenobiotic A xenobiotic (Greek, xenos "foreign"; bios "life") is a compound that is foreign to a living organism. Principal xenobiotics include: drugs, carcinogens and various compounds that have been introduced into the environment by artificial means. |
| Applications: | antineoplastic agent A substance that inhibits or prevents the proliferation of neoplasms. nicotinic acetylcholine receptor agonist An agonist that selectively binds to and activates a nicotinic acetylcholine receptor. interferon inducer An agent that promotes the production and release of interferons. anti-inflammatory agent Any compound that has anti-inflammatory effects. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| tilorone (CHEBI:147347) has role anti-inflammatory agent (CHEBI:67079) |
| tilorone (CHEBI:147347) has role antineoplastic agent (CHEBI:35610) |
| tilorone (CHEBI:147347) has role antiviral agent (CHEBI:22587) |
| tilorone (CHEBI:147347) has role EC 3.1.1.7 (acetylcholinesterase) inhibitor (CHEBI:38462) |
| tilorone (CHEBI:147347) has role interferon inducer (CHEBI:36710) |
| tilorone (CHEBI:147347) has role nicotinic acetylcholine receptor agonist (CHEBI:47958) |
| tilorone (CHEBI:147347) is a aromatic ether (CHEBI:35618) |
| tilorone (CHEBI:147347) is a diether (CHEBI:46786) |
| tilorone (CHEBI:147347) is a fluoren-9-ones (CHEBI:24057) |
| tilorone (CHEBI:147347) is a tertiary amino compound (CHEBI:50996) |
| tilorone (CHEBI:147347) is conjugate base of tilorone(2+) (CHEBI:147355) |
| Incoming Relation(s) |
| tilorone(2+) (CHEBI:147355) is conjugate acid of tilorone (CHEBI:147347) |
| IUPAC Name |
|---|
| 2,7-bis[2-(diethylamino)ethoxy]-9H-fluoren-9-one |
| INNs | Source |
|---|---|
| tiloronum | WHO MedNet |
| tilorona | WHO MedNet |
| tilorone | WHO MedNet |
| tilorone | WHO MedNet |
| Synonym | Source |
|---|---|
| 2,7-bis[2-(diethylamino)ethoxy]-9-fluorenone | ChEBI |
| Manual Xrefs | Databases |
|---|---|
| LSM-20974 | LINCS |
| Tilorone | Wikipedia |
| DB17965 | DrugBank |
| HMDB0259096 | HMDB |
| Registry Numbers | Sources |
|---|---|
| CAS:27591-97-5 | ChemIDplus |
| Citations |
|---|