EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C25H34N2O3 |
| Net Charge | 0 |
| Average Mass | 410.558 |
| Monoisotopic Mass | 410.25694 |
| SMILES | CCN(CC)CCOc1ccc2c(c1)C(=O)c1cc(OCCN(CC)CC)ccc1-2 |
| InChI | InChI=1S/C25H34N2O3/c1-5-26(6-2)13-15-29-19-9-11-21-22-12-10-20(30-16-14-27(7-3)8-4)18-24(22)25(28)23(21)17-19/h9-12,17-18H,5-8,13-16H2,1-4H3 |
| InChIKey | MPMFCABZENCRHV-UHFFFAOYSA-N |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| Biological Roles: | EC 3.1.1.7 (acetylcholinesterase) inhibitor An EC 3.1.1.* (carboxylic ester hydrolase) inhibitor that interferes with the action of enzyme acetylcholinesterase (EC 3.1.1.7), which helps breaking down of acetylcholine into choline and acetic acid. nicotinic acetylcholine receptor agonist An agonist that selectively binds to and activates a nicotinic acetylcholine receptor. antiviral agent A substance that destroys or inhibits replication of viruses. xenobiotic A xenobiotic (Greek, xenos "foreign"; bios "life") is a compound that is foreign to a living organism. Principal xenobiotics include: drugs, carcinogens and various compounds that have been introduced into the environment by artificial means. |
| Applications: | antineoplastic agent A substance that inhibits or prevents the proliferation of neoplasms. interferon inducer An agent that promotes the production and release of interferons. nicotinic acetylcholine receptor agonist An agonist that selectively binds to and activates a nicotinic acetylcholine receptor. anti-inflammatory agent Any compound that has anti-inflammatory effects. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| tilorone (CHEBI:147347) has role anti-inflammatory agent (CHEBI:67079) |
| tilorone (CHEBI:147347) has role antineoplastic agent (CHEBI:35610) |
| tilorone (CHEBI:147347) has role antiviral agent (CHEBI:22587) |
| tilorone (CHEBI:147347) has role EC 3.1.1.7 (acetylcholinesterase) inhibitor (CHEBI:38462) |
| tilorone (CHEBI:147347) has role interferon inducer (CHEBI:36710) |
| tilorone (CHEBI:147347) has role nicotinic acetylcholine receptor agonist (CHEBI:47958) |
| tilorone (CHEBI:147347) is a aromatic ether (CHEBI:35618) |
| tilorone (CHEBI:147347) is a diether (CHEBI:46786) |
| tilorone (CHEBI:147347) is a fluoren-9-ones (CHEBI:24057) |
| tilorone (CHEBI:147347) is a tertiary amino compound (CHEBI:50996) |
| tilorone (CHEBI:147347) is conjugate base of tilorone(2+) (CHEBI:147355) |
| Incoming Relation(s) |
| tilorone(2+) (CHEBI:147355) is conjugate acid of tilorone (CHEBI:147347) |
| IUPAC Name |
|---|
| 2,7-bis[2-(diethylamino)ethoxy]-9H-fluoren-9-one |
| INNs | Source |
|---|---|
| tilorona | WHO MedNet |
| tilorone | WHO MedNet |
| tilorone | WHO MedNet |
| tiloronum | WHO MedNet |
| Synonym | Source |
|---|---|
| 2,7-bis[2-(diethylamino)ethoxy]-9-fluorenone | ChEBI |
| Manual Xrefs | Databases |
|---|---|
| DB17965 | DrugBank |
| HMDB0259096 | HMDB |
| LSM-20974 | LINCS |
| Tilorone | Wikipedia |
| Registry Numbers | Sources |
|---|---|
| CAS:27591-97-5 | ChemIDplus |
| Citations |
|---|