EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C25H34N2O3.2HCl |
| Net Charge | 0 |
| Average Mass | 483.480 |
| Monoisotopic Mass | 482.21030 |
| SMILES | CCN(CC)CCOc1ccc2c(c1)C(=O)c1cc(OCCN(CC)CC)ccc1-2.Cl.Cl |
| InChI | InChI=1S/C25H34N2O3.2ClH/c1-5-26(6-2)13-15-29-19-9-11-21-22-12-10-20(30-16-14-27(7-3)8-4)18-24(22)25(28)23(21)17-19;;/h9-12,17-18H,5-8,13-16H2,1-4H3;2*1H |
| InChIKey | BSVYJQAWONIOOU-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Biological Roles: | antiviral drug A substance used in the prophylaxis or therapy of virus diseases. nicotinic acetylcholine receptor agonist An agonist that selectively binds to and activates a nicotinic acetylcholine receptor. |
| Applications: | antineoplastic agent A substance that inhibits or prevents the proliferation of neoplasms. antiviral drug A substance used in the prophylaxis or therapy of virus diseases. interferon inducer An agent that promotes the production and release of interferons. nicotinic acetylcholine receptor agonist An agonist that selectively binds to and activates a nicotinic acetylcholine receptor. anti-inflammatory agent Any compound that has anti-inflammatory effects. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| tilorone dihydrochloride (CHEBI:147356) has part tilorone(2+) (CHEBI:147355) |
| tilorone dihydrochloride (CHEBI:147356) has role anti-inflammatory agent (CHEBI:67079) |
| tilorone dihydrochloride (CHEBI:147356) has role antineoplastic agent (CHEBI:35610) |
| tilorone dihydrochloride (CHEBI:147356) has role antiviral drug (CHEBI:36044) |
| tilorone dihydrochloride (CHEBI:147356) has role interferon inducer (CHEBI:36710) |
| tilorone dihydrochloride (CHEBI:147356) has role nicotinic acetylcholine receptor agonist (CHEBI:47958) |
| tilorone dihydrochloride (CHEBI:147356) is a hydrochloride (CHEBI:36807) |
| IUPAC Name |
|---|
| 2,7-bis[2-(diethylamino)ethoxy]-9H-fluoren-9-one dihydrochloride |
| Synonyms | Source |
|---|---|
| tilorone HCl | ChemIDplus |
| tilorone hydrochloride | ChemIDplus |
| Brand Names | Source |
|---|---|
| Amixin | ChEBI |
| Lavomax | ChEBI |
| Manual Xrefs | Databases |
|---|---|
| D06149 | KEGG DRUG |
| DBSALT003375 | DrugBank |
| Registry Numbers | Sources |
|---|---|
| CAS:27591-69-1 | ChemIDplus |
| Citations |
|---|