EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C25H34N2O3.2HCl |
| Net Charge | 0 |
| Average Mass | 483.480 |
| Monoisotopic Mass | 482.21030 |
| SMILES | CCN(CC)CCOc1ccc2c(c1)C(=O)c1cc(OCCN(CC)CC)ccc1-2.Cl.Cl |
| InChI | InChI=1S/C25H34N2O3.2ClH/c1-5-26(6-2)13-15-29-19-9-11-21-22-12-10-20(30-16-14-27(7-3)8-4)18-24(22)25(28)23(21)17-19;;/h9-12,17-18H,5-8,13-16H2,1-4H3;2*1H |
| InChIKey | BSVYJQAWONIOOU-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Biological Roles: | antiviral drug A substance used in the prophylaxis or therapy of virus diseases. nicotinic acetylcholine receptor agonist An agonist that selectively binds to and activates a nicotinic acetylcholine receptor. |
| Applications: | antiviral drug A substance used in the prophylaxis or therapy of virus diseases. antineoplastic agent A substance that inhibits or prevents the proliferation of neoplasms. anti-inflammatory agent Any compound that has anti-inflammatory effects. interferon inducer An agent that promotes the production and release of interferons. nicotinic acetylcholine receptor agonist An agonist that selectively binds to and activates a nicotinic acetylcholine receptor. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| tilorone dihydrochloride (CHEBI:147356) has part tilorone(2+) (CHEBI:147355) |
| tilorone dihydrochloride (CHEBI:147356) has role anti-inflammatory agent (CHEBI:67079) |
| tilorone dihydrochloride (CHEBI:147356) has role antineoplastic agent (CHEBI:35610) |
| tilorone dihydrochloride (CHEBI:147356) has role antiviral drug (CHEBI:36044) |
| tilorone dihydrochloride (CHEBI:147356) has role interferon inducer (CHEBI:36710) |
| tilorone dihydrochloride (CHEBI:147356) has role nicotinic acetylcholine receptor agonist (CHEBI:47958) |
| tilorone dihydrochloride (CHEBI:147356) is a hydrochloride (CHEBI:36807) |
| IUPAC Name |
|---|
| 2,7-bis[2-(diethylamino)ethoxy]-9H-fluoren-9-one dihydrochloride |
| Synonyms | Source |
|---|---|
| tilorone hydrochloride | ChemIDplus |
| tilorone HCl | ChemIDplus |
| Brand Names | Source |
|---|---|
| Amixin | ChEBI |
| Lavomax | ChEBI |
| Manual Xrefs | Databases |
|---|---|
| D06149 | KEGG DRUG |
| DBSALT003375 | DrugBank |
| Registry Numbers | Sources |
|---|---|
| CAS:27591-69-1 | ChemIDplus |
| Citations |
|---|