EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C9H12O4 |
| Net Charge | 0 |
| Average Mass | 184.191 |
| Monoisotopic Mass | 184.07356 |
| SMILES | [H]C(C(=O)CCC)=C([H])C([H])=C(O)C(=O)O |
| InChI | InChI=1S/C9H12O4/c1-2-4-7(10)5-3-6-8(11)9(12)13/h3,5-6,11H,2,4H2,1H3,(H,12,13) |
| InChIKey | XUNCLPUITPERRV-UHFFFAOYSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Pseudomonas sp. (ncbitaxon:306) | - | PubMed (8481010) | Strain: HBP1 |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| Biological Role: | bacterial xenobiotic metabolite Any bacterial metabolite produced by metabolism of a xenobiotic compound in bacteria. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 2-hydroxy-6-oxonona-2,4-dienoic acid (CHEBI:147339) has role bacterial xenobiotic metabolite (CHEBI:76976) |
| 2-hydroxy-6-oxonona-2,4-dienoic acid (CHEBI:147339) is a 2-hydroxy monocarboxylic acid (CHEBI:49302) |
| 2-hydroxy-6-oxonona-2,4-dienoic acid (CHEBI:147339) is a 6-oxo monocarboxylic acid (CHEBI:35960) |
| 2-hydroxy-6-oxonona-2,4-dienoic acid (CHEBI:147339) is a α,β-unsaturated monocarboxylic acid (CHEBI:79020) |
| 2-hydroxy-6-oxonona-2,4-dienoic acid (CHEBI:147339) is conjugate acid of 2-hydroxy-6-oxo-nona-2,4-dienoate (CHEBI:147333) |
| Incoming Relation(s) |
| 2-hydroxy-6-oxo-nona-2,4-dienoate (CHEBI:147333) is conjugate base of 2-hydroxy-6-oxonona-2,4-dienoic acid (CHEBI:147339) |
| IUPAC Name |
|---|
| 2-hydroxy-6-oxonona-2,4-dienoic acid |
| Citations |
|---|