EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C20H25N2OS |
| Net Charge | +1 |
| Average Mass | 341.500 |
| Monoisotopic Mass | 341.16821 |
| SMILES | C[NH+](C)CCCSc1ccccc1NC(=O)/C=C/c1ccccc1 |
| InChI | InChI=1S/C20H24N2OS/c1-22(2)15-8-16-24-19-12-7-6-11-18(19)21-20(23)14-13-17-9-4-3-5-10-17/h3-7,9-14H,8,15-16H2,1-2H3,(H,21,23)/p+1/b14-13+ |
| InChIKey | RSUVYMGADVXGOU-BUHFOSPRSA-O |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| cinanserin(1+) (CHEBI:147283) is a ammonium ion derivative (CHEBI:35274) |
| cinanserin(1+) (CHEBI:147283) is conjugate acid of cinanserin (CHEBI:145999) |
| Incoming Relation(s) |
| cinanserin hydrochloride (CHEBI:147284) has part cinanserin(1+) (CHEBI:147283) |
| cinanserin (CHEBI:145999) is conjugate base of cinanserin(1+) (CHEBI:147283) |
| IUPAC Name |
|---|
| N,N-dimethyl-3-[(2-{[(2E)-3-phenylprop-2-enoyl]amino}phenyl)sulfanyl]propan-1-aminium |
| Synonym | Source |
|---|---|
| dimethyl-[3-[2-[[(E)-3-phenylprop-2-enoyl]amino]phenyl]sulfanylpropyl]azanium | ChEBI |