EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C20H24N2OS |
| Net Charge | 0 |
| Average Mass | 340.492 |
| Monoisotopic Mass | 340.16093 |
| SMILES | CN(C)CCCSc1ccccc1NC(=O)/C=C/c1ccccc1 |
| InChI | InChI=1S/C20H24N2OS/c1-22(2)15-8-16-24-19-12-7-6-11-18(19)21-20(23)14-13-17-9-4-3-5-10-17/h3-7,9-14H,8,15-16H2,1-2H3,(H,21,23)/b14-13+ |
| InChIKey | RSUVYMGADVXGOU-BUHFOSPRSA-N |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| Biological Roles: | anticoronaviral agent Any antiviral agent which inhibits the activity of coronaviruses. EC 3.4.22.69 (SARS coronavirus main proteinase) inhibitor An EC 3.4.22.* (cysteine endopeptidase) inhibitor that interferes with the action of SARS coronavirus main proteinase (EC 3.4.22.69). antiviral agent A substance that destroys or inhibits replication of viruses. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| cinanserin (CHEBI:145999) has role anticoronaviral agent (CHEBI:149553) |
| cinanserin (CHEBI:145999) has role antiviral agent (CHEBI:22587) |
| cinanserin (CHEBI:145999) has role EC 3.4.22.69 (SARS coronavirus main proteinase) inhibitor (CHEBI:147285) |
| cinanserin (CHEBI:145999) is a aryl sulfide (CHEBI:35683) |
| cinanserin (CHEBI:145999) is a cinnamamides (CHEBI:23247) |
| cinanserin (CHEBI:145999) is a secondary carboxamide (CHEBI:140325) |
| cinanserin (CHEBI:145999) is a tertiary amino compound (CHEBI:50996) |
| cinanserin (CHEBI:145999) is conjugate base of cinanserin(1+) (CHEBI:147283) |
| Incoming Relation(s) |
| cinanserin(1+) (CHEBI:147283) is conjugate acid of cinanserin (CHEBI:145999) |
| IUPAC Name |
|---|
| (2E)-N-(2-{[3-(dimethylamino)propyl]sulfanyl}phenyl)-3-phenylprop-2-enamide |
| INNs | Source |
|---|---|
| cinanserin | WHO MedNet |
| cinansérine | WHO MedNet |
| cinanserinum | WHO MedNet |
| cinanserina | WHO MedNet |
| Manual Xrefs | Databases |
|---|---|
| Cinanserin | Wikipedia |
| Registry Numbers | Sources |
|---|---|
| CAS:1166-34-3 | ChemIDplus |
| Citations |
|---|