EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C20H24N2OS.HCl |
| Net Charge | 0 |
| Average Mass | 376.953 |
| Monoisotopic Mass | 376.13761 |
| SMILES | CN(C)CCCSc1ccccc1NC(=O)/C=C/c1ccccc1.Cl |
| InChI | InChI=1S/C20H24N2OS.ClH/c1-22(2)15-8-16-24-19-12-7-6-11-18(19)21-20(23)14-13-17-9-4-3-5-10-17;/h3-7,9-14H,8,15-16H2,1-2H3,(H,21,23);1H/b14-13+; |
| InChIKey | LXGJPDKYMJJWRB-IERUDJENSA-N |
| Roles Classification |
|---|
| Biological Roles: | EC 3.4.22.69 (SARS coronavirus main proteinase) inhibitor An EC 3.4.22.* (cysteine endopeptidase) inhibitor that interferes with the action of SARS coronavirus main proteinase (EC 3.4.22.69). antiviral agent A substance that destroys or inhibits replication of viruses. anticoronaviral agent Any antiviral agent which inhibits the activity of coronaviruses. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| cinanserin hydrochloride (CHEBI:147284) has part cinanserin(1+) (CHEBI:147283) |
| cinanserin hydrochloride (CHEBI:147284) has role anticoronaviral agent (CHEBI:149553) |
| cinanserin hydrochloride (CHEBI:147284) has role antiviral agent (CHEBI:22587) |
| cinanserin hydrochloride (CHEBI:147284) has role EC 3.4.22.69 (SARS coronavirus main proteinase) inhibitor (CHEBI:147285) |
| cinanserin hydrochloride (CHEBI:147284) is a hydrochloride (CHEBI:36807) |
| IUPAC Name |
|---|
| (2E)-N-(2-{[3-(dimethylamino)propyl]sulfanyl}phenyl)-3-phenylprop-2-enamide hydrochloride |
| Synonyms | Source |
|---|---|
| cinanserin HCl | ChemIDplus |
| MAPTC | ChemIDplus |
| SQ 10,643 | ChemIDplus |
| SQ 10643 | ChemIDplus |
| Citations |
|---|