EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C12H13N5O4 |
| Net Charge | 0 |
| Average Mass | 291.267 |
| Monoisotopic Mass | 291.09675 |
| SMILES | N#C[C@@]1(c2ccc3c(N)ncnn23)O[C@H](CO)[C@@H](O)[C@H]1O |
| InChI | InChI=1S/C12H13N5O4/c13-4-12(10(20)9(19)7(3-18)21-12)8-2-1-6-11(14)15-5-16-17(6)8/h1-2,5,7,9-10,18-20H,3H2,(H2,14,15,16)/t7-,9-,10-,12+/m1/s1 |
| InChIKey | BRDWIEOJOWJCLU-LTGWCKQJSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| Biological Roles: | anticoronaviral agent Any antiviral agent which inhibits the activity of coronaviruses. antiviral agent A substance that destroys or inhibits replication of viruses. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| GS-441524 (CHEBI:147281) has role anticoronaviral agent (CHEBI:149553) |
| GS-441524 (CHEBI:147281) has role antiviral agent (CHEBI:22587) |
| GS-441524 (CHEBI:147281) has role drug metabolite (CHEBI:49103) |
| GS-441524 (CHEBI:147281) is a C-nucleoside (CHEBI:37086) |
| GS-441524 (CHEBI:147281) is a aromatic amine (CHEBI:33860) |
| GS-441524 (CHEBI:147281) is a nitrile (CHEBI:18379) |
| GS-441524 (CHEBI:147281) is a pyrrolotriazine (CHEBI:88341) |
| Incoming Relation(s) |
| GS-441524 monophosphate (CHEBI:150866) has functional parent GS-441524 (CHEBI:147281) |
| GS-443902 (CHEBI:150869) has functional parent GS-441524 (CHEBI:147281) |
| remdesivir (CHEBI:145994) has functional parent GS-441524 (CHEBI:147281) |
| IUPAC Name |
|---|
| (2R,3R,4S,5R)-2-(4-aminopyrrolo[2,1-f][1,2,4]triazin-7-yl)-3,4-dihydroxy-5-(hydroxymethyl)tetrahydrofuran-2-carbonitrile |
| Synonyms | Source |
|---|---|
| EVO 984 | ChEBI |
| EVO-984 | ChEBI |
| EVO984 | ChEBI |
| GS 441524 | ChEBI |
| GS441524 | ChEBI |
| Registry Numbers | Sources |
|---|---|
| CAS:1191237-69-0 | ChEBI |
| Citations |
|---|