EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C12H16N5O13P3 |
| Net Charge | 0 |
| Average Mass | 531.204 |
| Monoisotopic Mass | 530.99575 |
| SMILES | N#C[C@@]1(c2ccc3c(N)ncnn23)O[C@H](COP(=O)(O)OP(=O)(O)OP(=O)(O)O)[C@@H](O)[C@H]1O |
| InChI | InChI=1S/C12H16N5O13P3/c13-4-12(8-2-1-6-11(14)15-5-16-17(6)8)10(19)9(18)7(28-12)3-27-32(23,24)30-33(25,26)29-31(20,21)22/h1-2,5,7,9-10,18-19H,3H2,(H,23,24)(H,25,26)(H2,14,15,16)(H2,20,21,22)/t7-,9-,10-,12+/m1/s1 |
| InChIKey | DFVPCNAMNAPBCX-LTGWCKQJSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| Biological Roles: | anticoronaviral agent Any antiviral agent which inhibits the activity of coronaviruses. antiviral drug A substance used in the prophylaxis or therapy of virus diseases. |
| Application: | antiviral drug A substance used in the prophylaxis or therapy of virus diseases. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| GS-443902 (CHEBI:150869) has functional parent GS-441524 (CHEBI:147281) |
| GS-443902 (CHEBI:150869) has role anticoronaviral agent (CHEBI:149553) |
| GS-443902 (CHEBI:150869) has role antiviral drug (CHEBI:36044) |
| GS-443902 (CHEBI:150869) has role drug metabolite (CHEBI:49103) |
| GS-443902 (CHEBI:150869) is a C-nucleoside (CHEBI:37086) |
| GS-443902 (CHEBI:150869) is a aromatic amine (CHEBI:33860) |
| GS-443902 (CHEBI:150869) is a nitrile (CHEBI:18379) |
| GS-443902 (CHEBI:150869) is a organic triphosphate (CHEBI:62894) |
| GS-443902 (CHEBI:150869) is a pyrrolotriazine (CHEBI:88341) |
| IUPAC Name |
|---|
| ((2R,3S,4R,5R)-5-(4-Aminopyrrolo[2,1-f][1,2,4]triazin-7-yl)-5-cyano-3,4-dihydroxytetrahydrofuran-2-yl)methyl tetrahydrogen triphosphate |
| Synonyms | Source |
|---|---|
| GS-441524 triphosphate | ChemIDplus |
| RDV-TP | ChEBI |
| remdesivir triphosphate | ChemIDplus |
| Registry Numbers | Sources |
|---|---|
| CAS:1355149-45-9 | ChemIDplus |
| Citations |
|---|