EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C27H35N6O8P |
| Net Charge | 0 |
| Average Mass | 602.585 |
| Monoisotopic Mass | 602.22540 |
| SMILES | CCC(CC)COC(=O)[C@H](C)N[P@](=O)(OC[C@H]1O[C@@](C#N)(c2ccc3c(N)ncnn23)[C@H](O)[C@@H]1O)Oc1ccccc1 |
| InChI | InChI=1S/C27H35N6O8P/c1-4-18(5-2)13-38-26(36)17(3)32-42(37,41-19-9-7-6-8-10-19)39-14-21-23(34)24(35)27(15-28,40-21)22-12-11-20-25(29)30-16-31-33(20)22/h6-12,16-18,21,23-24,34-35H,4-5,13-14H2,1-3H3,(H,32,37)(H2,29,30,31)/t17-,21+,23+,24+,27-,42-/m0/s1 |
| InChIKey | RWWYLEGWBNMMLJ-YSOARWBDSA-N |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| Biological Roles: | antiviral drug A substance used in the prophylaxis or therapy of virus diseases. anticoronaviral agent Any antiviral agent which inhibits the activity of coronaviruses. |
| Applications: | prodrug A compound that, on administration, must undergo chemical conversion by metabolic processes before becoming the pharmacologically active drug for which it is a prodrug. antiviral drug A substance used in the prophylaxis or therapy of virus diseases. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| remdesivir (CHEBI:145994) has functional parent GS-441524 (CHEBI:147281) |
| remdesivir (CHEBI:145994) has role anticoronaviral agent (CHEBI:149553) |
| remdesivir (CHEBI:145994) has role antiviral drug (CHEBI:36044) |
| remdesivir (CHEBI:145994) has role prodrug (CHEBI:50266) |
| remdesivir (CHEBI:145994) is a C-nucleoside (CHEBI:37086) |
| remdesivir (CHEBI:145994) is a aromatic amine (CHEBI:33860) |
| remdesivir (CHEBI:145994) is a carboxylic ester (CHEBI:33308) |
| remdesivir (CHEBI:145994) is a nitrile (CHEBI:18379) |
| remdesivir (CHEBI:145994) is a phosphoramidate ester (CHEBI:27577) |
| remdesivir (CHEBI:145994) is a pyrrolotriazine (CHEBI:88341) |
| IUPAC Name |
|---|
| 2-ethylbutyl N-[(S)-{[(2R,3S,4R,5R)-5-(4-aminopyrrolo[2,1-f][1,2,4]triazin-7-yl)-5-cyano-3,4-dihydroxytetrahydrofuran-2-yl]methoxy}(phenoxy)phosphoryl]-L-alaninate |
| INNs | Source |
|---|---|
| remdesivir | WHO MedNet |
| remdesivir | WHO MedNet |
| remdésivir | WHO MedNet |
| remdesivirum | WHO MedNet |
| Synonyms | Source |
|---|---|
| 2-ethylbutyl (2S)-2-{[(S)-{[(2R,3S,4R,5R)-5-(4-aminopyrrolo[2,1-f][1,2,4]triazin-7-yl)-5-cyano-3,4-dihydroxytetrahydrofuran-2-yl]methoxy}(phenoxy)phosphoryl]amino}propanoate | ChEBI |
| (2S)-2-{(2R,3S,4R,5R)-[5-(4-Aminopyrrolo[2,1-f][1,2,4]triazin-7-yl)-5-cyano-3,4-dihydroxy-tetrahydro-furan-2-ylmethoxy]phenoxy-(S)-phosphorylamino}propionic acid 2-ethyl-butyl ester | ChEBI |
| GS 5734 | DrugBank |
| GS-5734 | ChemIDplus |
| GS5734 | ChEBI |
| Manual Xrefs | Databases |
|---|---|
| D11472 | KEGG DRUG |
| DB14761 | DrugBank |
| Remdesivir | Wikipedia |
| Registry Numbers | Sources |
|---|---|
| CAS:1809249-37-3 | ChemIDplus |
| Citations |
|---|