EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C8H11NO3 |
| Net Charge | 0 |
| Average Mass | 169.180 |
| Monoisotopic Mass | 169.07389 |
| SMILES | NC[C@H](O)c1ccc(O)c(O)c1 |
| InChI | InChI=1S/C8H11NO3/c9-4-8(12)5-1-2-6(10)7(11)3-5/h1-3,8,10-12H,4,9H2/t8-/m0/s1 |
| InChIKey | SFLSHLFXELFNJZ-QMMMGPOBSA-N |
| Wikipedia |
|---|
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Mus musculus (ncbitaxon:10090) | - | PubMed (19425150) | Source: BioModels - MODEL1507180067 |
| Roles Classification |
|---|
| Chemical Roles: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| Biological Roles: | anti-obesity agent Any substance which is used to reduce or control weight. neurotransmitter An endogenous compound that is used to transmit information across the synapse between a neuron and another cell. sympathomimetic agent A drug that mimics the effects of stimulating postganglionic adrenergic sympathetic nerves. Included in this class are drugs that directly stimulate adrenergic receptors and drugs that act indirectly by provoking the release of adrenergic transmitters. alpha-adrenergic agonist An agent that selectively binds to and activates α-adrenergic receptors. mouse metabolite Any mammalian metabolite produced during a metabolic reaction in a mouse (Mus musculus). human xenobiotic metabolite Any human metabolite produced by metabolism of a xenobiotic compound in humans. |
| Applications: | dermatologic drug A drug used to treat or prevent skin disorders or for the routine care of skin. anti-inflammatory agent Any compound that has anti-inflammatory effects. neuroprotective agent Any compound that can be used for the treatment of neurodegenerative disorders. cardiovascular drug A drug that affects the rate or intensity of cardiac contraction, blood vessel diameter or blood volume. sympathomimetic agent A drug that mimics the effects of stimulating postganglionic adrenergic sympathetic nerves. Included in this class are drugs that directly stimulate adrenergic receptors and drugs that act indirectly by provoking the release of adrenergic transmitters. alpha-adrenergic agonist An agent that selectively binds to and activates α-adrenergic receptors. antidepressant Antidepressants are mood-stimulating drugs used primarily in the treatment of affective disorders and related conditions. vasoconstrictor agent Drug used to cause constriction of the blood vessels. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| (R)-noradrenaline (CHEBI:18357) has role anti-inflammatory agent (CHEBI:67079) |
| (R)-noradrenaline (CHEBI:18357) has role anti-obesity agent (CHEBI:74518) |
| (R)-noradrenaline (CHEBI:18357) has role antidepressant (CHEBI:35469) |
| (R)-noradrenaline (CHEBI:18357) has role cardiovascular drug (CHEBI:35554) |
| (R)-noradrenaline (CHEBI:18357) has role dermatologic drug (CHEBI:50177) |
| (R)-noradrenaline (CHEBI:18357) has role mouse metabolite (CHEBI:75771) |
| (R)-noradrenaline (CHEBI:18357) has role neuroprotective agent (CHEBI:63726) |
| (R)-noradrenaline (CHEBI:18357) has role neurotransmitter (CHEBI:25512) |
| (R)-noradrenaline (CHEBI:18357) has role sympathomimetic agent (CHEBI:35524) |
| (R)-noradrenaline (CHEBI:18357) has role vasoconstrictor agent (CHEBI:50514) |
| (R)-noradrenaline (CHEBI:18357) has role α-adrenergic agonist (CHEBI:35569) |
| (R)-noradrenaline (CHEBI:18357) is a noradrenaline (CHEBI:33569) |
| (R)-noradrenaline (CHEBI:18357) is conjugate base of (R)-noradrenaline(1+) (CHEBI:72587) |
| (R)-noradrenaline (CHEBI:18357) is enantiomer of (S)-noradrenaline (CHEBI:33571) |
| Incoming Relation(s) |
| N-[(2R)-2-(3,4-dihydroxyphenyl)-2-hydroxyethyl]-L-glutamine residue (CHEBI:167178) has functional parent (R)-noradrenaline (CHEBI:18357) |
| (R)-noradrenaline(1+) (CHEBI:72587) is conjugate acid of (R)-noradrenaline (CHEBI:18357) |
| (S)-noradrenaline (CHEBI:33571) is enantiomer of (R)-noradrenaline (CHEBI:18357) |
| IUPAC Name |
|---|
| 4-[(1R)-2-amino-1-hydroxyethyl]benzene-1,2-diol |
| INNs | Source |
|---|---|
| norepinefrina | ChEBI |
| norepinephrine | ChemIDplus |
| norépinéphrine | WHO MedNet |
| norepinephrinum | ChEBI |
| Synonyms | Source |
|---|---|
| 4-[(1R)-2-Amino-1-hydroxyethyl]-1,2-benzenediol | KEGG COMPOUND |
| (−)-arterenol | ChemIDplus |
| Arterenol | KEGG COMPOUND |
| (R)-4-(2-amino-1-hydroxyethyl)-1,2-benzenediol | ChemIDplus |
| (R)-(−)-norepinephrine | ChemIDplus |
| (R)-norepinephrine | ChemIDplus |
| Manual Xrefs | Databases |
|---|---|
| 1960 | DrugCentral |
| C00001424 | KNApSAcK |
| C00547 | KEGG COMPOUND |
| C00547 | KEGG COMPOUND |
| D00076 | KEGG DRUG |
| DB00368 | DrugBank |
| HMDB0000216 | HMDB |
| LNR | PDBeChem |
| Norepinephrine | Wikipedia |
| Registry Numbers | Sources |
|---|---|
| Reaxys:2804840 | Reaxys |
| Beilstein:4231961 | Beilstein |
| CAS:51-41-2 | KEGG COMPOUND |
| CAS:51-41-2 | ChemIDplus |
| Citations |
|---|