EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C10H8O4 |
| Net Charge | 0 |
| Average Mass | 192.170 |
| Monoisotopic Mass | 192.04226 |
| SMILES | Cc1cc(O)cc2oc(=O)cc(O)c12 |
| InChI | InChI=1S/C10H8O4/c1-5-2-6(11)3-8-10(5)7(12)4-9(13)14-8/h2-4,11-12H,1H3 |
| InChIKey | OZEQMLIYSCBNBR-UHFFFAOYSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Aspergillus desertorum (ncbitaxon:1810909) | - | PubMed (28050053) | |
| Aloe megalacantha (ncbitaxon:1389516) | root (BTO:0001188) | PubMed (28686200) |
| Roles Classification |
|---|
| Biological Roles: | plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. Aspergillus metabolite Any fungal metabolite produced during a metabolic reaction in the mould, Aspergillus . |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 4,7-dihydroxy-5-methylcoumarin (CHEBI:146006) has role Aspergillus metabolite (CHEBI:76956) |
| 4,7-dihydroxy-5-methylcoumarin (CHEBI:146006) has role plant metabolite (CHEBI:76924) |
| 4,7-dihydroxy-5-methylcoumarin (CHEBI:146006) is a hydroxycoumarin (CHEBI:37912) |
| 4,7-dihydroxy-5-methylcoumarin (CHEBI:146006) is conjugate acid of 4,7-dihydroxy-5-methylcoumarin(1−) (CHEBI:145990) |
| Incoming Relation(s) |
| 7-demethylsiderin (CHEBI:145991) has functional parent 4,7-dihydroxy-5-methylcoumarin (CHEBI:146006) |
| 4,7-dihydroxy-5-methylcoumarin(1−) (CHEBI:145990) is conjugate base of 4,7-dihydroxy-5-methylcoumarin (CHEBI:146006) |
| IUPAC Name |
|---|
| 4,7-dihydroxy-5-methyl-2H-chromen-2-one |
| Synonym | Source |
|---|---|
| 4,7-dihydroxy-5-methyl-2H-1-benzopyran-2-one | IUPAC |
| Citations |
|---|