EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C11H10O4 |
| Net Charge | 0 |
| Average Mass | 206.197 |
| Monoisotopic Mass | 206.05791 |
| SMILES | COc1cc(=O)oc2cc(O)cc(C)c12 |
| InChI | InChI=1S/C11H10O4/c1-6-3-7(12)4-9-11(6)8(14-2)5-10(13)15-9/h3-5,12H,1-2H3 |
| InChIKey | UMLNUFLSRYJZFA-UHFFFAOYSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Cladosporium herbarum (ncbitaxon:29918) | - | PubMed (16038560) | Strain: IFB-E002 |
| Roles Classification |
|---|
| Biological Role: | fungal metabolite Any eukaryotic metabolite produced during a metabolic reaction in fungi, the kingdom that includes microorganisms such as the yeasts and moulds. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 7-demethylsiderin (CHEBI:145991) has functional parent 4,7-dihydroxy-5-methylcoumarin (CHEBI:146006) |
| 7-demethylsiderin (CHEBI:145991) has role fungal metabolite (CHEBI:76946) |
| 7-demethylsiderin (CHEBI:145991) is a aromatic ether (CHEBI:35618) |
| 7-demethylsiderin (CHEBI:145991) is a hydroxycoumarin (CHEBI:37912) |
| IUPAC Name |
|---|
| 7-hydroxy-4-methoxy-5-methyl-2H-chromen-2-one |
| Synonyms | Source |
|---|---|
| 7-hydroxy-4-methoxy-5-methyl-2H-1-benzopyran-2-one | IUPAC |
| 4-methoxy-5-methyl-7-hydroxycoumarin | ChEBI |
| UniProt Name | Source |
|---|---|
| 7-demethylsiderin | UniProt |
| Registry Numbers | Sources |
|---|---|
| CAS:41680-12-0 | ChEBI |
| Citations |
|---|