EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C10H7O4 |
| Net Charge | -1 |
| Average Mass | 191.162 |
| Monoisotopic Mass | 191.03498 |
| SMILES | Cc1cc(O)cc2oc(=O)cc([O-])c12 |
| InChI | InChI=1S/C10H8O4/c1-5-2-6(11)3-8-10(5)7(12)4-9(13)14-8/h2-4,11-12H,1H3/p-1 |
| InChIKey | OZEQMLIYSCBNBR-UHFFFAOYSA-M |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 4,7-dihydroxy-5-methylcoumarin(1−) (CHEBI:145990) is a organic anion (CHEBI:25696) |
| 4,7-dihydroxy-5-methylcoumarin(1−) (CHEBI:145990) is conjugate base of 4,7-dihydroxy-5-methylcoumarin (CHEBI:146006) |
| Incoming Relation(s) |
| 4,7-dihydroxy-5-methylcoumarin (CHEBI:146006) is conjugate acid of 4,7-dihydroxy-5-methylcoumarin(1−) (CHEBI:145990) |
| IUPAC Name |
|---|
| 7-hydroxy-5-methyl-2-oxo-2H-chromen-4-olate |
| Synonym | Source |
|---|---|
| 7-hydroxy-5-methyl-2-oxo-2H-1-benzopyran-4-olate | IUPAC |
| UniProt Name | Source |
|---|---|
| 4,7-dihydroxy-5-methylcoumarin | UniProt |
| Citations |
|---|