EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C37H48N4O5 |
| Net Charge | 0 |
| Average Mass | 628.814 |
| Monoisotopic Mass | 628.36247 |
| SMILES | Cc1cccc(C)c1OCC(=O)N[C@@H](Cc1ccccc1)[C@@H](O)C[C@H](Cc1ccccc1)NC(=O)[C@H](C(C)C)N1CCCNC1=O |
| InChI | InChI=1S/C37H48N4O5/c1-25(2)34(41-20-12-19-38-37(41)45)36(44)39-30(21-28-15-7-5-8-16-28)23-32(42)31(22-29-17-9-6-10-18-29)40-33(43)24-46-35-26(3)13-11-14-27(35)4/h5-11,13-18,25,30-32,34,42H,12,19-24H2,1-4H3,(H,38,45)(H,39,44)(H,40,43)/t30-,31-,32-,34-/m0/s1 |
| InChIKey | KJHKTHWMRKYKJE-SUGCFTRWSA-N |
| Roles Classification |
|---|
| Chemical Roles: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| Biological Roles: | anticoronaviral agent Any antiviral agent which inhibits the activity of coronaviruses. HIV protease inhibitor An inhibitor of HIV protease, an enzyme required for production of proteins needed for viral assembly. antiviral drug A substance used in the prophylaxis or therapy of virus diseases. |
| Applications: | antiviral drug A substance used in the prophylaxis or therapy of virus diseases. central nervous system stimulant Any drug that enhances the activity of the central nervous system. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| lopinavir (CHEBI:31781) has role anticoronaviral agent (CHEBI:149553) |
| lopinavir (CHEBI:31781) has role antiviral drug (CHEBI:36044) |
| lopinavir (CHEBI:31781) has role HIV protease inhibitor (CHEBI:35660) |
| lopinavir (CHEBI:31781) is a amphetamines (CHEBI:35338) |
| lopinavir (CHEBI:31781) is a dicarboxylic acid diamide (CHEBI:35779) |
| Incoming Relation(s) |
| Kaletra (CHEBI:145924) has part lopinavir (CHEBI:31781) |
| IUPAC Name |
|---|
| (2S)-N-[(2S,4S,5S)-5-{[(2,6-dimethylphenoxy)acetyl]amino}-4-hydroxy-1,6-diphenylhexan-2-yl]-3-methyl-2-(2-oxotetrahydropyrimidin-1(2H)-yl)butanamide |
| Synonym | Source |
|---|---|
| Lopinavir | KEGG COMPOUND |
| Registry Numbers | Sources |
|---|---|
| Reaxys:9309881 | Reaxys |
| CAS:192725-17-0 | KEGG COMPOUND |
| CAS:192725-17-0 | ChemIDplus |
| Citations |
|---|