EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C19H25N4O3 |
| Net Charge | +1 |
| Average Mass | 357.434 |
| Monoisotopic Mass | 357.19212 |
| SMILES | Nc1c(NC/C=C\COc2cc(C[NH+]3CCCCC3)ccn2)c(=O)c1=O |
| InChI | InChI=1S/C19H24N4O3/c20-16-17(19(25)18(16)24)22-7-2-5-11-26-15-12-14(6-8-21-15)13-23-9-3-1-4-10-23/h2,5-6,8,12,22H,1,3-4,7,9-11,13,20H2/p+1/b5-2- |
| InChIKey | XMDYZASWLGWIPL-DJWKRKHSSA-O |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| pibutidine(1+) (CHEBI:145665) is a piperidinium ion (CHEBI:48633) |
| pibutidine(1+) (CHEBI:145665) is conjugate acid of pibutidine (CHEBI:145662) |
| Incoming Relation(s) |
| pibutidine hydrochloride (CHEBI:32000) has part pibutidine(1+) (CHEBI:145665) |
| pibutidine (CHEBI:145662) is conjugate base of pibutidine(1+) (CHEBI:145665) |
| IUPAC Name |
|---|
| 1-{[2-({(2Z)-4-[(2-amino-3,4-dioxocyclobut-1-en-1-yl)amino]but-2-en-1-yl}oxy)pyridin-4-yl]methyl}piperidinium |
| Synonym | Source |
|---|---|
| pibutidine cation | ChEBI |