EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C19H24N4O3 |
| Net Charge | 0 |
| Average Mass | 356.426 |
| Monoisotopic Mass | 356.18484 |
| SMILES | Nc1c(NC/C=C\COc2cc(CN3CCCCC3)ccn2)c(=O)c1=O |
| InChI | InChI=1S/C19H24N4O3/c20-16-17(19(25)18(16)24)22-7-2-5-11-26-15-12-14(6-8-21-15)13-23-9-3-1-4-10-23/h2,5-6,8,12,22H,1,3-4,7,9-11,13,20H2/b5-2- |
| InChIKey | XMDYZASWLGWIPL-DJWKRKHSSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| Biological Role: | H2-receptor antagonist H2-receptor antagonists are the drugs that selectively bind to but do not activate histamine H2 receptors, thereby blocking the actions of endogenous histamine. |
| Applications: | anti-ulcer drug One of various classes of drugs with different action mechanisms used to treat or ameliorate peptic ulcer or irritation of the gastrointestinal tract. H2-receptor antagonist H2-receptor antagonists are the drugs that selectively bind to but do not activate histamine H2 receptors, thereby blocking the actions of endogenous histamine. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| pibutidine (CHEBI:145662) has role anti-ulcer drug (CHEBI:49201) |
| pibutidine (CHEBI:145662) has role H2-receptor antagonist (CHEBI:37961) |
| pibutidine (CHEBI:145662) is a aromatic ether (CHEBI:35618) |
| pibutidine (CHEBI:145662) is a cyclobutenones (CHEBI:59718) |
| pibutidine (CHEBI:145662) is a olefinic compound (CHEBI:78840) |
| pibutidine (CHEBI:145662) is a piperidines (CHEBI:26151) |
| pibutidine (CHEBI:145662) is a primary amino compound (CHEBI:50994) |
| pibutidine (CHEBI:145662) is a pyridines (CHEBI:26421) |
| pibutidine (CHEBI:145662) is a secondary amino compound (CHEBI:50995) |
| pibutidine (CHEBI:145662) is conjugate base of pibutidine(1+) (CHEBI:145665) |
| Incoming Relation(s) |
| pibutidine(1+) (CHEBI:145665) is conjugate acid of pibutidine (CHEBI:145662) |
| IUPAC Name |
|---|
| 3-amino-4-{[(2Z)-4-{[4-(piperidin-1-ylmethyl)pyridin-2-yl]oxy}but-2-en-1-yl]amino}cyclobut-3-ene-1,2-dione |
| INNs | Source |
|---|---|
| pibutidina | WHO MedNet |
| pibutidine | WHO MedNet |
| pibutidine | WHO MedNet |
| pibutidinum | WHO MedNet |
| Synonym | Source |
|---|---|
| 3-amino-4-[[(Z)-4-[4-(piperidinomethyl)pyridin-2-yloxy]-2-butenyl]amino]-3-cyclobutene-1,2-dione | ChEBI |
| Manual Xrefs | Databases |
|---|---|
| HMDB0041986 | HMDB |
| Registry Numbers | Sources |
|---|---|
| CAS:103922-33-4 | ChemIDplus |
| Citations |
|---|