EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C19H24N4O3.HCl |
| Net Charge | 0 |
| Average Mass | 392.887 |
| Monoisotopic Mass | 392.16152 |
| SMILES | Cl.Nc1c(NC/C=C\COc2cc(CN3CCCCC3)ccn2)c(=O)c1=O |
| InChI | InChI=1S/C19H24N4O3.ClH/c20-16-17(19(25)18(16)24)22-7-2-5-11-26-15-12-14(6-8-21-15)13-23-9-3-1-4-10-23;/h2,5-6,8,12,22H,1,3-4,7,9-11,13,20H2;1H/b5-2-; |
| InChIKey | ODBOENMSSFCACZ-PVOKDAACSA-N |
| Roles Classification |
|---|
| Biological Role: | H2-receptor antagonist H2-receptor antagonists are the drugs that selectively bind to but do not activate histamine H2 receptors, thereby blocking the actions of endogenous histamine. |
| Applications: | H2-receptor antagonist H2-receptor antagonists are the drugs that selectively bind to but do not activate histamine H2 receptors, thereby blocking the actions of endogenous histamine. anti-ulcer drug One of various classes of drugs with different action mechanisms used to treat or ameliorate peptic ulcer or irritation of the gastrointestinal tract. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| pibutidine hydrochloride (CHEBI:32000) has part pibutidine(1+) (CHEBI:145665) |
| pibutidine hydrochloride (CHEBI:32000) has role anti-ulcer drug (CHEBI:49201) |
| pibutidine hydrochloride (CHEBI:32000) has role H2-receptor antagonist (CHEBI:37961) |
| pibutidine hydrochloride (CHEBI:32000) is a hydrochloride (CHEBI:36807) |
| IUPAC Name |
|---|
| 3-amino-4-{[(2Z)-4-{[4-(piperidin-1-ylmethyl)pyridin-2-yl]oxy}but-2-en-1-yl]amino}cyclobut-3-ene-1,2-dione hydrochloride |
| Synonyms | Source |
|---|---|
| pibutidine hydrochloride | KEGG DRUG |
| IT 066 | KEGG DRUG |
| IT-066 | ChemIDplus |
| pibutidine HCl | ChEBI |
| 3-amino-4-[4-[4-(1-piperidinomethyl)-2-pyridyloxy]-cis-2- butenylamino]-3-cyclobutene-1,2-dione hydrochloride | ChEBI |
| pibutidine monohydrochloride | ChEBI |
| Manual Xrefs | Databases |
|---|---|
| D01861 | KEGG DRUG |
| Registry Numbers | Sources |
|---|---|
| CAS:126463-66-9 | ChemIDplus |
| Citations |
|---|