EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C18H23O3S |
| Net Charge | -1 |
| Average Mass | 319.446 |
| Monoisotopic Mass | 319.13734 |
| SMILES | CC(C)(C)c1ccc2c(S(=O)(=O)[O-])c(C(C)(C)C)ccc2c1 |
| InChI | InChI=1S/C18H24O3S/c1-17(2,3)13-8-9-14-12(11-13)7-10-15(18(4,5)6)16(14)22(19,20)21/h7-11H,1-6H3,(H,19,20,21)/p-1 |
| InChIKey | WBEBQCINXJDZCX-UHFFFAOYSA-M |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Application: | antitussive An agent that suppresses cough. Antitussives have a central or a peripheral action on the cough reflex, or a combination of both. Compare with expectorants, which are considered to increase the volume of secretions in the respiratory tract, so facilitating their removal by ciliary action and coughing, and mucolytics, which decrease the viscosity of mucus, facilitating its removal by ciliary action and expectoration. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| dibunate (CHEBI:145567) has role antitussive (CHEBI:51177) |
| dibunate (CHEBI:145567) is a naphthalenemonosulfonate (CHEBI:25471) |
| dibunate (CHEBI:145567) is conjugate base of dibunic acid (CHEBI:146215) |
| Incoming Relation(s) |
| sodium dibunate (CHEBI:31479) has part dibunate (CHEBI:145567) |
| dibunic acid (CHEBI:146215) is conjugate acid of dibunate (CHEBI:145567) |
| IUPAC Name |
|---|
| 2,6-di-tert-butylnaphthalene-1-sulfonate |
| INNs | Source |
|---|---|
| dibunato | WHO MedNet |
| dibunate | WHO MedNet |
| dibunas | WHO MedNet |
| dibunate | WHO MedNet |
| Synonyms | Source |
|---|---|
| acide dibunique | WHO MedNet |
| dibunic acid(1−) | ChEBI |
| 2,6-bis(1,1-dimethylethyl)-1-naphthalenesulfonate | ChEBI |
| Registry Numbers | Sources |
|---|---|
| CAS:14992-58-6 | ChemIDplus |