EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C18H24O3S |
| Net Charge | 0 |
| Average Mass | 320.454 |
| Monoisotopic Mass | 320.14462 |
| SMILES | CC(C)(C)c1ccc2c(S(=O)(=O)O)c(C(C)(C)C)ccc2c1 |
| InChI | InChI=1S/C18H24O3S/c1-17(2,3)13-8-9-14-12(11-13)7-10-15(18(4,5)6)16(14)22(19,20)21/h7-11H,1-6H3,(H,19,20,21) |
| InChIKey | WBEBQCINXJDZCX-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Application: | antitussive An agent that suppresses cough. Antitussives have a central or a peripheral action on the cough reflex, or a combination of both. Compare with expectorants, which are considered to increase the volume of secretions in the respiratory tract, so facilitating their removal by ciliary action and coughing, and mucolytics, which decrease the viscosity of mucus, facilitating its removal by ciliary action and expectoration. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| dibunic acid (CHEBI:146215) has role antitussive (CHEBI:51177) |
| dibunic acid (CHEBI:146215) is a naphthalenesulfonic acid (CHEBI:36336) |
| dibunic acid (CHEBI:146215) is conjugate acid of dibunate (CHEBI:145567) |
| Incoming Relation(s) |
| dibunate (CHEBI:145567) is conjugate base of dibunic acid (CHEBI:146215) |
| IUPAC Name |
|---|
| 2,6-di-tert-butylnaphthalene-1-sulfonic acid |
| Synonym | Source |
|---|---|
| 2,6-bis(1,1-dimethylethyl)-1-naphthalenesulfonic acid | ChEBI |