EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C18H23O3S.Na |
| Net Charge | 0 |
| Average Mass | 342.436 |
| Monoisotopic Mass | 342.12656 |
| SMILES | CC(C)(C)c1ccc2c(S(=O)(=O)[O-])c(C(C)(C)C)ccc2c1.[Na+] |
| InChI | InChI=1S/C18H24O3S.Na/c1-17(2,3)13-8-9-14-12(11-13)7-10-15(18(4,5)6)16(14)22(19,20)21;/h7-11H,1-6H3,(H,19,20,21);/q;+1/p-1 |
| InChIKey | XYEXKDCAGSHWSD-UHFFFAOYSA-M |
| Roles Classification |
|---|
| Application: | antitussive An agent that suppresses cough. Antitussives have a central or a peripheral action on the cough reflex, or a combination of both. Compare with expectorants, which are considered to increase the volume of secretions in the respiratory tract, so facilitating their removal by ciliary action and coughing, and mucolytics, which decrease the viscosity of mucus, facilitating its removal by ciliary action and expectoration. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| sodium dibunate (CHEBI:31479) has part dibunate (CHEBI:145567) |
| sodium dibunate (CHEBI:31479) has role antitussive (CHEBI:51177) |
| sodium dibunate (CHEBI:31479) is a organic sodium salt (CHEBI:38700) |
| sodium dibunate (CHEBI:31479) is a organosulfonate salt (CHEBI:64382) |
| IUPAC Name |
|---|
| sodium 2,6-di-tert-butylnaphthalene-1-sulfonate |
| INNs | Source |
|---|---|
| dibunate de sodium | WHO MedNet |
| dibunato de sodio | WHO MedNet |
| natrii dibunas | WHO MedNet |
| sodium dibunate | WHO MedNet |
| Synonyms | Source |
|---|---|
| 2,6-bis(1,1-dimethylethyl)-1-naphthalenesulfonic acid sodium salt | ChEBI |
| 2,6-di-tert-butyl-1-naphthalenesulfonic acid sodium salt | ChEBI |
| dibunate sodium | KEGG DRUG |
| L 1633 | ChemIDplus |
| L-1633 | ChemIDplus |
| sodium 2,6-di-tert-butyl-1-naphthalenesulfonate | ChEBI |
| Brand Names | Source |
|---|---|
| Becantal | ChEBI |
| Becantex | ChEBI |
| Bechisan | ChemIDplus |
| Bekantil | ChemIDplus |
| Keuten | ChEBI |
| Linctussal | ChEBI |
| Registry Numbers | Sources |
|---|---|
| CAS:14992-59-7 | KEGG COMPOUND |
| CAS:14992-59-7 | ChemIDplus |
| Citations |
|---|