EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C8H10N4O2 |
| Net Charge | 0 |
| Average Mass | 194.194 |
| Monoisotopic Mass | 194.08038 |
| SMILES | CCCn1c(=O)nc(=O)c2ncnc21 |
| InChI | InChI=1S/C8H10N4O2/c1-2-3-12-6-5(9-4-10-6)7(13)11-8(12)14/h4H,2-3H2,1H3,(H,9,10)(H,11,13,14) |
| InChIKey | SIQPXVQCUCHWDI-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Applications: | bronchodilator agent An agent that causes an increase in the expansion of a bronchus or bronchial tubes. anti-asthmatic drug A drug used to treat asthma. non-steroidal anti-inflammatory drug An anti-inflammatory drug that is not a steroid. In addition to anti-inflammatory actions, non-steroidal anti-inflammatory drugs have analgesic, antipyretic, and platelet-inhibitory actions. They act by blocking the synthesis of prostaglandins by inhibiting cyclooxygenase, which converts arachidonic acid to cyclic endoperoxides, precursors of prostaglandins. anti-arrhythmia drug A drug used for the treatment or prevention of cardiac arrhythmias. Anti-arrhythmia drugs may affect the polarisation-repolarisation phase of the action potential, its excitability or refractoriness, or impulse conduction or membrane responsiveness within cardiac fibres. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| enprofylline (CHEBI:126237) has role anti-arrhythmia drug (CHEBI:38070) |
| enprofylline (CHEBI:126237) has role anti-asthmatic drug (CHEBI:49167) |
| enprofylline (CHEBI:126237) has role bronchodilator agent (CHEBI:35523) |
| enprofylline (CHEBI:126237) has role non-steroidal anti-inflammatory drug (CHEBI:35475) |
| enprofylline (CHEBI:126237) is a oxopurine (CHEBI:25810) |
| Incoming Relation(s) |
| 1-methyl-3-propyl-7H-xanthine (CHEBI:145517) has functional parent enprofylline (CHEBI:126237) |
| IUPAC Name |
|---|
| 3-propyl-3,7-dihydro-1H-purine-2,6-dione |
| INNs | Source |
|---|---|
| enprofilina | ChemIDplus |
| enprofylline | ChemIDplus |
| enprofyllinum | ChemIDplus |
| Synonyms | Source |
|---|---|
| 3,7-dihydro-3-propyl-1H-purine-2,6-dione | ChemIDplus |
| 3-n-propylxanthine | DrugBank |
| 3-Propyl-3,7-dihydro-purine-2,6-dione | ChEMBL |
| 3-propylxanthine | ChemIDplus |
| Enprofylline | ChEMBL |
| Registry Numbers | Sources |
|---|---|
| Beilstein:4189165 | Beilstein |
| CAS:41078-02-8 | KEGG DRUG |
| CAS:41078-02-8 | ChemIDplus |