EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C8H10N4O2 |
| Net Charge | 0 |
| Average Mass | 194.194 |
| Monoisotopic Mass | 194.08038 |
| SMILES | CCCn1c(=O)nc(=O)c2ncnc21 |
| InChI | InChI=1S/C8H10N4O2/c1-2-3-12-6-5(9-4-10-6)7(13)11-8(12)14/h4H,2-3H2,1H3,(H,9,10)(H,11,13,14) |
| InChIKey | SIQPXVQCUCHWDI-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Applications: | non-steroidal anti-inflammatory drug An anti-inflammatory drug that is not a steroid. In addition to anti-inflammatory actions, non-steroidal anti-inflammatory drugs have analgesic, antipyretic, and platelet-inhibitory actions. They act by blocking the synthesis of prostaglandins by inhibiting cyclooxygenase, which converts arachidonic acid to cyclic endoperoxides, precursors of prostaglandins. anti-arrhythmia drug A drug used for the treatment or prevention of cardiac arrhythmias. Anti-arrhythmia drugs may affect the polarisation-repolarisation phase of the action potential, its excitability or refractoriness, or impulse conduction or membrane responsiveness within cardiac fibres. bronchodilator agent An agent that causes an increase in the expansion of a bronchus or bronchial tubes. anti-asthmatic drug A drug used to treat asthma. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| enprofylline (CHEBI:126237) has role anti-arrhythmia drug (CHEBI:38070) |
| enprofylline (CHEBI:126237) has role anti-asthmatic drug (CHEBI:49167) |
| enprofylline (CHEBI:126237) has role bronchodilator agent (CHEBI:35523) |
| enprofylline (CHEBI:126237) has role non-steroidal anti-inflammatory drug (CHEBI:35475) |
| enprofylline (CHEBI:126237) is a organic molecular entity (CHEBI:50860) |
| enprofylline (CHEBI:126237) is a oxopurine (CHEBI:25810) |
| Incoming Relation(s) |
| 1-methyl-3-propyl-7H-xanthine (CHEBI:145517) has functional parent enprofylline (CHEBI:126237) |
| IUPAC Name |
|---|
| 3-propyl-3,7-dihydro-1H-purine-2,6-dione |
| INNs | Source |
|---|---|
| enprofilina | ChemIDplus |
| enprofylline | ChemIDplus |
| enprofyllinum | ChemIDplus |
| Synonyms | Source |
|---|---|
| 3,7-dihydro-3-propyl-1H-purine-2,6-dione | ChemIDplus |
| 3-n-propylxanthine | DrugBank |
| 3-Propyl-3,7-dihydro-purine-2,6-dione | ChEMBL |
| 3-propylxanthine | ChemIDplus |
| D 4028 | ChEMBL |
| D-4028 | ChEMBL |
| Registry Numbers | Sources |
|---|---|
| Beilstein:4189165 | Beilstein |
| CAS:41078-02-8 | KEGG DRUG |
| CAS:41078-02-8 | ChemIDplus |
| Citations |
|---|