EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C16H17NO2 |
| Net Charge | 0 |
| Average Mass | 255.317 |
| Monoisotopic Mass | 255.12593 |
| SMILES | O=C(N[C@H](CO)Cc1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C16H17NO2/c18-12-15(11-13-7-3-1-4-8-13)17-16(19)14-9-5-2-6-10-14/h1-10,15,18H,11-12H2,(H,17,19)/t15-/m0/s1 |
| InChIKey | RFYNAVYPYXLVOM-HNNXBMFYSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Aspergillus flavipes (ncbitaxon:41900) | |||
| - | PubMed (7517439) | ||
| - | PubMed (875642) | Strain: ATCC 11013 | |
| Catharanthus pusillus (IPNI:77879-1) | whole plant (BTO:0001461) | PubMed (5853193) | |
| Coleus forskohlii (IPNI:445992-1) | - | PubMed (19938546) | |
| Diospyros quaesita (IPNI:322922-1) | - | PubMed (19035573) | Isolated from leaves, twigs and branches. |
| Viola yedoensis (IPNI:869562-1) | - | PubMed (29493149) |
| Roles Classification |
|---|
| Biological Roles: | plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. fungal metabolite Any eukaryotic metabolite produced during a metabolic reaction in fungi, the kingdom that includes microorganisms such as the yeasts and moulds. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| N-benzoyl-L-phenylalaninol (CHEBI:145107) has functional parent L-phenylalaninol (CHEBI:45086) |
| N-benzoyl-L-phenylalaninol (CHEBI:145107) has functional parent benzoic acid (CHEBI:30746) |
| N-benzoyl-L-phenylalaninol (CHEBI:145107) has role fungal metabolite (CHEBI:76946) |
| N-benzoyl-L-phenylalaninol (CHEBI:145107) has role plant metabolite (CHEBI:76924) |
| N-benzoyl-L-phenylalaninol (CHEBI:145107) is a benzamides (CHEBI:22702) |
| N-benzoyl-L-phenylalaninol (CHEBI:145107) is a primary alcohol (CHEBI:15734) |
| N-benzoyl-L-phenylalaninol (CHEBI:145107) is a secondary carboxamide (CHEBI:140325) |
| Incoming Relation(s) |
| asperphenamate (CHEBI:145105) has functional parent N-benzoyl-L-phenylalaninol (CHEBI:145107) |
| IUPAC Name |
|---|
| N-[(2S)-1-hydroxy-3-phenylpropan-2-yl]benzamide |
| UniProt Name | Source |
|---|---|
| N-benzoyl-L-phenylalaninol | UniProt |
| Registry Numbers | Sources |
|---|---|
| CAS:4503-96-2 | ChemIDplus |
| Citations |
|---|