EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C9H13NO |
| Net Charge | 0 |
| Average Mass | 151.209 |
| Monoisotopic Mass | 151.09971 |
| SMILES | N[C@H](CO)Cc1ccccc1 |
| InChI | InChI=1S/C9H13NO/c10-9(7-11)6-8-4-2-1-3-5-8/h1-5,9,11H,6-7,10H2/t9-/m0/s1 |
| InChIKey | STVVMTBJNDTZBF-VIFPVBQESA-N |
| Roles Classification |
|---|
| Chemical Roles: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| Application: | central nervous system stimulant Any drug that enhances the activity of the central nervous system. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| L-phenylalaninol (CHEBI:45086) is a amino alcohol (CHEBI:22478) |
| L-phenylalaninol (CHEBI:45086) is a amphetamines (CHEBI:35338) |
| L-phenylalaninol (CHEBI:45086) is a primary alcohol (CHEBI:15734) |
| L-phenylalaninol (CHEBI:45086) is a primary amino compound (CHEBI:50994) |
| Incoming Relation(s) |
| N-benzoyl-L-phenylalaninol (CHEBI:145107) has functional parent L-phenylalaninol (CHEBI:45086) |
| IUPAC Name |
|---|
| (2S)-2-amino-3-phenylpropan-1-ol |
| Synonyms | Source |
|---|---|
| (−)-2-amino-3-phenyl-1-propanol | ChEBI |
| (S)-(−)-2-amino-3-phenyl-1-propanol | ChEBI |
| (S)-2-benzylethanolamine | ChemIDplus |
| (S)-phenylalaninol | ChemIDplus |
| (S)-β-aminobenzenepropanol | ChemIDplus |
| L-2-amino-3-phenyl-1-propanol | ChemIDplus |
| Citations |
|---|