EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C10H17O2 |
| Net Charge | -1 |
| Average Mass | 169.244 |
| Monoisotopic Mass | 169.12340 |
| SMILES | CC(C)=CCC[C@H](C)CC(=O)[O-] |
| InChI | InChI=1S/C10H18O2/c1-8(2)5-4-6-9(3)7-10(11)12/h5,9H,4,6-7H2,1-3H3,(H,11,12)/p-1/t9-/m0/s1 |
| InChIKey | GJWSUKYXUMVMGX-VIFPVBQESA-M |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| (S)-citronellate (CHEBI:143914) is a medium-chain fatty acid anion (CHEBI:59558) |
| (S)-citronellate (CHEBI:143914) is a monounsaturated fatty acid anion (CHEBI:82680) |
| (S)-citronellate (CHEBI:143914) is conjugate base of (S)-citronellic acid (CHEBI:144575) |
| Incoming Relation(s) |
| (S)-citronellic acid (CHEBI:144575) is conjugate acid of (S)-citronellate (CHEBI:143914) |
| IUPAC Name |
|---|
| (3S)-3,7-dimethyloct-6-enoate |
| Synonyms | Source |
|---|---|
| (3S)-3,7-dimethyl-6-octenoate | ChEBI |
| (S)-3,7-dimethyl-6-octenoate | ChEBI |
| UniProt Name | Source |
|---|---|
| (S)-(−)-citronellate | UniProt |
| Manual Xrefs | Databases |
|---|---|
| CPD-12894 | MetaCyc |