EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
CHEBI:17594 - hydroquinone
| Formula | C6H6O2 |
| Net Charge | 0 |
| Average Mass | 110.112 |
| Monoisotopic Mass | 110.03678 |
| SMILES | Oc1ccc(O)cc1 |
| InChI | InChI=1S/C6H6O2/c7-5-1-2-6(8)4-3-5/h1-4,7-8H |
| InChIKey | QIGBRXMKCJKVMJ-UHFFFAOYSA-N |
| Wikipedia |
|---|
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Escherichia coli (ncbitaxon:562) | - | PubMed (21988831) | |
| Mus musculus (ncbitaxon:10090) | - | PubMed (19425150) | Source: BioModels - MODEL1507180067 |
| Roles Classification |
|---|
| Chemical Role: | antioxidant A substance that opposes oxidation or inhibits reactions brought about by dioxygen or peroxides. |
| Biological Roles: | mouse metabolite Any mammalian metabolite produced during a metabolic reaction in a mouse (Mus musculus). Escherichia coli metabolite Any bacterial metabolite produced during a metabolic reaction in Escherichia coli. carcinogenic agent A role played by a chemical compound which is known to induce a process of carcinogenesis by corrupting normal cellular pathways, leading to the acquistion of tumoral capabilities. cofactor An organic molecule or ion (usually a metal ion) that is required by an enzyme for its activity. It may be attached either loosely (coenzyme) or tightly (prosthetic group). human xenobiotic metabolite Any human metabolite produced by metabolism of a xenobiotic compound in humans. |
| Application: | skin lightening agent Any cosmetic used to lighten the colour of skin by reducing the concentration of melanin. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| hydroquinone (CHEBI:17594) has role Escherichia coli metabolite (CHEBI:76971) |
| hydroquinone (CHEBI:17594) has role antioxidant (CHEBI:22586) |
| hydroquinone (CHEBI:17594) has role carcinogenic agent (CHEBI:50903) |
| hydroquinone (CHEBI:17594) has role cofactor (CHEBI:23357) |
| hydroquinone (CHEBI:17594) has role human xenobiotic metabolite (CHEBI:76967) |
| hydroquinone (CHEBI:17594) has role mouse metabolite (CHEBI:75771) |
| hydroquinone (CHEBI:17594) has role skin lightening agent (CHEBI:85046) |
| hydroquinone (CHEBI:17594) is a benzenediol (CHEBI:17701) |
| hydroquinone (CHEBI:17594) is a hydroquinones (CHEBI:24646) |
| Incoming Relation(s) |
| 2,5-dihydroxybenzenesulfonic acid (CHEBI:71157) has functional parent hydroquinone (CHEBI:17594) |
| 2,6-dibromohydroquinone (CHEBI:19390) has functional parent hydroquinone (CHEBI:17594) |
| 4-hydroxyphenyl acetate (CHEBI:31128) has functional parent hydroquinone (CHEBI:17594) |
| chlorohydroquinones (CHEBI:23147) has functional parent hydroquinone (CHEBI:17594) |
| gentisyl alcohol (CHEBI:5325) has functional parent hydroquinone (CHEBI:17594) |
| hydroquinone O-β-D-glucopyranoside (CHEBI:18305) has functional parent hydroquinone (CHEBI:17594) |
| monobenzone (CHEBI:34380) has functional parent hydroquinone (CHEBI:17594) |
| quinol sulfate (CHEBI:71062) has functional parent hydroquinone (CHEBI:17594) |
| quinhydrone (CHEBI:26491) has part hydroquinone (CHEBI:17594) |
| IUPAC Name |
|---|
| benzene-1,4-diol |
| Synonyms | Source |
|---|---|
| 1,4-Benzenediol | KEGG COMPOUND |
| 1,4-Dihydroxybenzene | KEGG COMPOUND |
| 4-Hydroxyphenol | KEGG COMPOUND |
| Benzene-1,4-diol | KEGG COMPOUND |
| Eldoquin | ChemIDplus |
| p-hydroxyphenol | NIST Chemistry WebBook |
| UniProt Name | Source |
|---|---|
| hydroquinone | UniProt |
| Manual Xrefs | Databases |
|---|---|
| 1503 | PPDB |
| 3282 | DrugCentral |
| C00002656 | KNApSAcK |
| C00530 | KEGG COMPOUND |
| c0091 | UM-BBD |
| C15603 | KEGG COMPOUND |
| D00073 | KEGG DRUG |
| HMDB0002434 | HMDB |
| Hydroquinone | Wikipedia |
| HYDROQUINONE | MetaCyc |
| Citations |
|---|