EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C12H21O3 |
| Net Charge | -1 |
| Average Mass | 213.297 |
| Monoisotopic Mass | 213.14962 |
| SMILES | [H]C(=O)CCCCCCCCCCC(=O)[O-] |
| InChI | InChI=1S/C12H22O3/c13-11-9-7-5-3-1-2-4-6-8-10-12(14)15/h11H,1-10H2,(H,14,15)/p-1 |
| InChIKey | KGEACANGAYABKT-UHFFFAOYSA-M |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 12-oxododecanoate (CHEBI:144067) is a aldehydic acid anion (CHEBI:71944) |
| 12-oxododecanoate (CHEBI:144067) is a medium-chain fatty acid anion (CHEBI:59558) |
| 12-oxododecanoate (CHEBI:144067) is a ω-oxo fatty acid anion (CHEBI:76309) |
| 12-oxododecanoate (CHEBI:144067) is conjugate base of 12-oxododecanoic acid (CHEBI:144066) |
| Incoming Relation(s) |
| 12-oxododecanoic acid (CHEBI:144066) is conjugate acid of 12-oxododecanoate (CHEBI:144067) |
| IUPAC Name |
|---|
| 12-oxododecanoate |
| Synonyms | Source |
|---|---|
| 12-oxolaurate | ChEBI |
| 12-oxododecanoic acid(1−) | ChEBI |
| 11-formylundecanoate | ChEBI |
| UniProt Name | Source |
|---|---|
| 12-oxododecanoate | UniProt |
| Citations |
|---|