EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C12H22O3 |
| Net Charge | 0 |
| Average Mass | 214.305 |
| Monoisotopic Mass | 214.15689 |
| SMILES | [H]C(=O)CCCCCCCCCCC(=O)O |
| InChI | InChI=1S/C12H22O3/c13-11-9-7-5-3-1-2-4-6-8-10-12(14)15/h11H,1-10H2,(H,14,15) |
| InChIKey | KGEACANGAYABKT-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 12-oxododecanoic acid (CHEBI:144066) has functional parent dodecanoic acid (CHEBI:30805) |
| 12-oxododecanoic acid (CHEBI:144066) is a aldehydic acid (CHEBI:26643) |
| 12-oxododecanoic acid (CHEBI:144066) is a medium-chain fatty acid (CHEBI:59554) |
| 12-oxododecanoic acid (CHEBI:144066) is a oxo monocarboxylic acid (CHEBI:35871) |
| 12-oxododecanoic acid (CHEBI:144066) is a ω-oxo fatty acid (CHEBI:76328) |
| 12-oxododecanoic acid (CHEBI:144066) is conjugate acid of 12-oxododecanoate (CHEBI:144067) |
| Incoming Relation(s) |
| 12-oxododecanoate (CHEBI:144067) is conjugate base of 12-oxododecanoic acid (CHEBI:144066) |
| IUPAC Name |
|---|
| 12-oxododecanoic acid |
| Synonyms | Source |
|---|---|
| 11-formylundecanoic acid | ChEBI |
| 12-oxolauric acid | SUBMITTER |
| ω-oxolauric acid | ChEBI |
| Manual Xrefs | Databases |
|---|---|
| LMFA01060089 | LIPID MAPS |
| Registry Numbers | Sources |
|---|---|
| CAS:3956-80-7 | ChemIDplus |
| Citations |
|---|