EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C13H9BrN4O3 |
| Net Charge | 0 |
| Average Mass | 349.144 |
| Monoisotopic Mass | 347.98580 |
| SMILES | O=C1CN(N=Cc2ncc(-c3ccc(Br)cc3)o2)C(=O)N1 |
| InChI | InChI=1S/C13H9BrN4O3/c14-9-3-1-8(2-4-9)10-5-15-12(21-10)6-16-18-7-11(19)17-13(18)20/h1-6H,7H2,(H,17,19,20) |
| InChIKey | SEGCNGONCZQFDW-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Biological Role: | |
| Application: | muscle relaxant A drug used to produce muscle relaxation (excepting neuromuscular blocking agents). Its primary clinical and therapeutic use is the treatment of muscle spasm and immobility associated with strains, sprains, and injuries of the back and, to a lesser degree, injuries to the neck. Also used for the treatment of a variety of clinical conditions that have in common only the presence of skeletal muscle hyperactivity, for example, the muscle spasms that can occur in multiple sclerosis. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| azumolene (CHEBI:143225) has role muscle relaxant (CHEBI:51371) |
| azumolene (CHEBI:143225) has role ryanodine receptor modulator (CHEBI:38809) |
| azumolene (CHEBI:143225) is a 1,3-oxazoles (CHEBI:46812) |
| azumolene (CHEBI:143225) is a bromobenzenes (CHEBI:37149) |
| azumolene (CHEBI:143225) is a imidazolidine-2,4-dione (CHEBI:24628) |
| azumolene (CHEBI:143225) is conjugate acid of azumolene(1−) (CHEBI:143232) |
| Incoming Relation(s) |
| azumolene(1−) (CHEBI:143232) is conjugate base of azumolene (CHEBI:143225) |
| IUPAC Name |
|---|
| 1-({[5-(4-bromophenyl)-1,3-oxazol-2-yl]methylidene}amino)imidazolidine-2,4-dione |
| INNs | Source |
|---|---|
| azumoléne | WHO MedNet |
| azumolenum | WHO MedNet |
| azumolene | WHO MedNet |
| azumoleno | WHO MedNet |
| Synonym | Source |
|---|---|
| 1-[[[5-(4-bromophenyl)-2-oxazolyl]methylene]amino]hydantoin | ChEBI |
| Manual Xrefs | Databases |
|---|---|
| US4861790 | Patent |
| WO2009152205 | Patent |
| Registry Numbers | Sources |
|---|---|
| CAS:64748-79-4 | ChemIDplus |
| Citations |
|---|