EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C13H8BrN4O3 |
| Net Charge | -1 |
| Average Mass | 348.136 |
| Monoisotopic Mass | 346.97853 |
| SMILES | O=C1CN(N=Cc2ncc(-c3ccc(Br)cc3)o2)C(=O)[N-]1 |
| InChI | InChI=1S/C13H9BrN4O3/c14-9-3-1-8(2-4-9)10-5-15-12(21-10)6-16-18-7-11(19)17-13(18)20/h1-6H,7H2,(H,17,19,20)/p-1 |
| InChIKey | SEGCNGONCZQFDW-UHFFFAOYSA-M |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| azumolene(1−) (CHEBI:143232) is a organic anion (CHEBI:25696) |
| azumolene(1−) (CHEBI:143232) is conjugate base of azumolene (CHEBI:143225) |
| Incoming Relation(s) |
| azumolene sodium (CHEBI:143169) has part azumolene(1−) (CHEBI:143232) |
| azumolene (CHEBI:143225) is conjugate acid of azumolene(1−) (CHEBI:143232) |
| IUPAC Name |
|---|
| 3-({[5-(4-bromophenyl)-1,3-oxazol-2-yl]methylidene}amino)-2,5-dioxoimidazolidin-1-ide |
| Synonym | Source |
|---|---|
| azumolene anion | ChEBI |