EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C20H28O4 |
| Net Charge | 0 |
| Average Mass | 332.440 |
| Monoisotopic Mass | 332.19876 |
| SMILES | [H][C@@]12CC[C@@H]3C[C@]1(CC3=C)[C@@H](C(=O)O)[C@@]1([H])[C@@]2(C)CCC[C@@]1(C)C(=O)O |
| InChI | InChI=1S/C20H28O4/c1-11-9-20-10-12(11)5-6-13(20)18(2)7-4-8-19(3,17(23)24)15(18)14(20)16(21)22/h12-15H,1,4-10H2,2-3H3,(H,21,22)(H,23,24)/t12-,13+,14-,15+,18+,19-,20+/m1/s1 |
| InChIKey | UJFQJDAESQJXTG-UFUZVNNQSA-N |
| Roles Classification |
|---|
| Chemical Roles: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| Biological Role: | plant hormone A plant growth regulator that modulates the formation of stems, leaves and flowers, as well as the development and ripening of fruit. The term includes endogenous and non-endogenous compounds (e.g. active compounds produced by bacteria on the leaf surface) as well as semi-synthetic and fully synthetic compounds. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| gibberellin A12 (CHEBI:30088) is a C20-gibberellin (CHEBI:20859) |
| gibberellin A12 (CHEBI:30088) is a dicarboxylic acid (CHEBI:35692) |
| gibberellin A12 (CHEBI:30088) is conjugate acid of gibberellin A12(2−) (CHEBI:58627) |
| Incoming Relation(s) |
| gibberellin A110 (CHEBI:133478) has functional parent gibberellin A12 (CHEBI:30088) |
| gibberellin A12 aldehyde (CHEBI:15610) has functional parent gibberellin A12 (CHEBI:30088) |
| gibberellin A13 (CHEBI:72598) has functional parent gibberellin A12 (CHEBI:30088) |
| gibberellin A18 (CHEBI:142026) has functional parent gibberellin A12 (CHEBI:30088) |
| gibberellin A25 (CHEBI:72601) has functional parent gibberellin A12 (CHEBI:30088) |
| gibberellin A12(2−) (CHEBI:58627) is conjugate base of gibberellin A12 (CHEBI:30088) |
| IUPAC Names |
|---|
| 1β,4a-dimethyl-8-methylidene-4aα,4bβ-gibbane-1α,10β-dicarboxylic acid |
| (1R,2S,3S,4R,8S,9S,12R)-4,8-dimethyl-13-methylidenetetracyclo[10.2.1.01,9.03,8]pentadecane-2,4-dicarboxylic acid |
| Synonyms | Source |
|---|---|
| Gibberellin A12 | KEGG COMPOUND |
| GA12 | ChEBI |
| gibberellin 12 | ChEBI |
| Gibberellin-A-12 | ChemIDplus |
| Manual Xrefs | Databases |
|---|---|
| C11857 | KEGG COMPOUND |
| LMPR0104170014 | LIPID MAPS |
| C00000012 | KNApSAcK |
| Registry Numbers | Sources |
|---|---|
| CAS:1164-45-0 | KEGG COMPOUND |
| CAS:1164-45-0 | ChemIDplus |