EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C20H28O5 |
| Net Charge | 0 |
| Average Mass | 348.439 |
| Monoisotopic Mass | 348.19367 |
| SMILES | [H][C@@]12CC[C@@H]3C[C@]1(CC3=C)[C@@H](C(=O)O)[C@@]1([H])[C@@]2(C)C[C@H](O)C[C@@]1(C)C(=O)O |
| InChI | InChI=1S/C20H28O5/c1-10-6-20-7-11(10)4-5-13(20)18(2)8-12(21)9-19(3,17(24)25)15(18)14(20)16(22)23/h11-15,21H,1,4-9H2,2-3H3,(H,22,23)(H,24,25)/t11-,12+,13+,14-,15+,18+,19-,20+/m1/s1 |
| InChIKey | SFGDEUSMQMGAFH-MJPABCAUSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Arabidopsis thaliana (ncbitaxon:3702) | - | MetaboLights (MTBLS129) | |
| Elaeis guineensis (ncbitaxon:51953) | amniotic fluid (BTO:0000068) | PubMed (9433811) | |
| Spinacia oleracea (ncbitaxon:3562) | leaf (BTO:0000713) | PubMed (9433811) | |
| Cucumis sativus (ncbitaxon:3659) | - | PubMed (23507362) |
| Roles Classification |
|---|
| Chemical Roles: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| Biological Roles: | plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. plant hormone A plant growth regulator that modulates the formation of stems, leaves and flowers, as well as the development and ripening of fruit. The term includes endogenous and non-endogenous compounds (e.g. active compounds produced by bacteria on the leaf surface) as well as semi-synthetic and fully synthetic compounds. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| gibberellin A110 (CHEBI:133478) has functional parent gibberellin A12 (CHEBI:30088) |
| gibberellin A110 (CHEBI:133478) has role plant metabolite (CHEBI:76924) |
| gibberellin A110 (CHEBI:133478) is a C20-gibberellin (CHEBI:20859) |
| gibberellin A110 (CHEBI:133478) is a dicarboxylic acid (CHEBI:35692) |
| gibberellin A110 (CHEBI:133478) is a olefinic compound (CHEBI:78840) |
| gibberellin A110 (CHEBI:133478) is a secondary alcohol (CHEBI:35681) |
| IUPAC Name |
|---|
| (1α,3β,4aα,4bβ,10β)-3-hydroxy-1,4a-dimethyl-8-methylidenegibbane-1,10-dicarboxylic acid |
| Synonym | Source |
|---|---|
| GA110 | KNApSAcK |
| Manual Xrefs | Databases |
|---|---|
| HMDB0032010 | HMDB |
| C00007873 | KNApSAcK |
| CPD-475 | MetaCyc |
| Registry Numbers | Sources |
|---|---|
| Reaxys:7389053 | Reaxys |
| CAS:202057-27-0 | KNApSAcK |
| Citations |
|---|