EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
CHEBI:72601 - gibberellin A25
| Formula | C20H26O6 |
| Net Charge | 0 |
| Average Mass | 362.422 |
| Monoisotopic Mass | 362.17294 |
| SMILES | [H][C@@]12CC[C@@H]3C[C@]1(CC3=C)[C@@H](C(=O)O)[C@@]1([H])[C@@]2(C(=O)O)CCC[C@@]1(C)C(=O)O |
| InChI | InChI=1S/C20H26O6/c1-10-8-19-9-11(10)4-5-12(19)20(17(25)26)7-3-6-18(2,16(23)24)14(20)13(19)15(21)22/h11-14H,1,3-9H2,2H3,(H,21,22)(H,23,24)(H,25,26)/t11-,12-,13-,14-,18-,19+,20-/m1/s1 |
| InChIKey | XOUJCIPAKFLTCI-POPXMCHDSA-N |
| Roles Classification |
|---|
| Chemical Roles: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| Biological Role: | plant hormone A plant growth regulator that modulates the formation of stems, leaves and flowers, as well as the development and ripening of fruit. The term includes endogenous and non-endogenous compounds (e.g. active compounds produced by bacteria on the leaf surface) as well as semi-synthetic and fully synthetic compounds. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| gibberellin A25 (CHEBI:72601) has functional parent gibberellin A12 (CHEBI:30088) |
| gibberellin A25 (CHEBI:72601) is a C20-gibberellin (CHEBI:20859) |
| gibberellin A25 (CHEBI:72601) is a tricarboxylic acid (CHEBI:27093) |
| gibberellin A25 (CHEBI:72601) is conjugate acid of gibberellin A25(3−) (CHEBI:143959) |
| Incoming Relation(s) |
| gibberellin A25(3−) (CHEBI:143959) is conjugate base of gibberellin A25 (CHEBI:72601) |
| IUPAC Names |
|---|
| (1R,4aR,4bR,7R,9aR,10S,10aR)-1-methyl-8-methylenedodecahydro-4aH-7,9a-methanobenzo[a]azulene-1,4a,10-tricarboxylic acid |
| (1α,4aα,4bβ,10β)-1-methyl-8-methylenegibbane-1,4a,10-tricarboxylic acid |
| Manual Xrefs | Databases |
|---|---|
| CPD1F-84 | MetaCyc |
| Registry Numbers | Sources |
|---|---|
| Reaxys:2785117 | Reaxys |
| Citations |
|---|