EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C20H28O6 |
| Net Charge | 0 |
| Average Mass | 364.438 |
| Monoisotopic Mass | 364.18859 |
| SMILES | [H][C@@]12CC[C@]3(O)C[C@]1(CC3=C)[C@@H](C(=O)O)[C@@]1([H])[C@@]2(C)CC[C@H](O)[C@@]1(C)C(=O)O |
| InChI | InChI=1S/C20H28O6/c1-10-8-19-9-20(10,26)7-4-11(19)17(2)6-5-12(21)18(3,16(24)25)14(17)13(19)15(22)23/h11-14,21,26H,1,4-9H2,2-3H3,(H,22,23)(H,24,25)/t11-,12-,13+,14-,17-,18+,19-,20-/m0/s1 |
| InChIKey | GPOAVBQIYNXVEA-JOJUGDBLSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Lupinus luteus (ncbitaxon:5127) | - | PubMed (24232845) |
| Roles Classification |
|---|
| Chemical Roles: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| Biological Roles: | plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. plant hormone A plant growth regulator that modulates the formation of stems, leaves and flowers, as well as the development and ripening of fruit. The term includes endogenous and non-endogenous compounds (e.g. active compounds produced by bacteria on the leaf surface) as well as semi-synthetic and fully synthetic compounds. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| gibberellin A18 (CHEBI:142026) has functional parent gibberellin A12 (CHEBI:30088) |
| gibberellin A18 (CHEBI:142026) has role plant metabolite (CHEBI:76924) |
| gibberellin A18 (CHEBI:142026) is a C20-gibberellin (CHEBI:20859) |
| gibberellin A18 (CHEBI:142026) is a dicarboxylic acid (CHEBI:35692) |
| IUPAC Name |
|---|
| 2β,7-dihydroxy-1α,4aα-dimethyl-8-methylidenegibbane-1α,10β-dicarboxylic acid |
| Synonyms | Source |
|---|---|
| 2β,7-dihydroxy-1α,4aα-dimethyl-8-methylenegibbane-1α,10β-dicarboxylic acid | IUPAC |
| GA18 | ChEBI |
| Registry Numbers | Sources |
|---|---|
| Reaxys:2678859 | Reaxys |
| Citations |
|---|