EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C8H4Cl3O2 |
| Net Charge | -1 |
| Average Mass | 238.477 |
| Monoisotopic Mass | 236.92824 |
| SMILES | O=C([O-])Cc1c(Cl)ccc(Cl)c1Cl |
| InChI | InChI=1S/C8H5Cl3O2/c9-5-1-2-6(10)8(11)4(5)3-7(12)13/h1-2H,3H2,(H,12,13)/p-1 |
| InChIKey | QZXCCPZJCKEPSA-UHFFFAOYSA-M |
| Roles Classification |
|---|
| Biological Role: | synthetic auxin A synthetic compound exhibiting auxin activity. |
| Application: | herbicide A substance used to destroy plant pests. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| chlorfenac(1−) (CHEBI:142831) has role herbicide (CHEBI:24527) |
| chlorfenac(1−) (CHEBI:142831) has role synthetic auxin (CHEBI:26841) |
| chlorfenac(1−) (CHEBI:142831) is a monocarboxylic acid anion (CHEBI:35757) |
| chlorfenac(1−) (CHEBI:142831) is conjugate base of chlorfenac (CHEBI:82235) |
| Incoming Relation(s) |
| chlorfenac-ammonium (CHEBI:142832) has part chlorfenac(1−) (CHEBI:142831) |
| chlorfenac-sodium (CHEBI:142833) has part chlorfenac(1−) (CHEBI:142831) |
| chlorfenac (CHEBI:82235) is conjugate acid of chlorfenac(1−) (CHEBI:142831) |
| IUPAC Name |
|---|
| (2,3,6-trichlorophenyl)acetate |
| Synonym | Source |
|---|---|
| 2,3,6-trichlorobenzeneacetate | ChEBI |