EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C8H4Cl3O2.H4N |
| Net Charge | 0 |
| Average Mass | 256.516 |
| Monoisotopic Mass | 254.96206 |
| SMILES | O=C([O-])Cc1c(Cl)ccc(Cl)c1Cl.[NH4+] |
| InChI | InChI=1S/C8H5Cl3O2.H3N/c9-5-1-2-6(10)8(11)4(5)3-7(12)13;/h1-2H,3H2,(H,12,13);1H3 |
| InChIKey | DZRJBVFMFCMALE-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Biological Role: | synthetic auxin A synthetic compound exhibiting auxin activity. |
| Applications: | agrochemical An agrochemical is a substance that is used in agriculture or horticulture. herbicide A substance used to destroy plant pests. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| chlorfenac-ammonium (CHEBI:142832) has part chlorfenac(1−) (CHEBI:142831) |
| chlorfenac-ammonium (CHEBI:142832) has role agrochemical (CHEBI:33286) |
| chlorfenac-ammonium (CHEBI:142832) has role herbicide (CHEBI:24527) |
| chlorfenac-ammonium (CHEBI:142832) has role synthetic auxin (CHEBI:26841) |
| chlorfenac-ammonium (CHEBI:142832) is a ammonium salt (CHEBI:47704) |
| IUPAC Name |
|---|
| ammonium (2,3,6-trichlorophenyl)acetate |
| Synonyms | Source |
|---|---|
| 2,3,6-trichlorobenzeneacetic acid ammonium salt | ChemIDplus |
| ammonium 2,3,6-trichlorobenzeneacetate | ChEBI |
| ammonium chlorfenac | ChemIDplus |
| 2,3,6-trichlorophenylacetic acid, ammonium salt | ChemIDplus |
| Manual Xrefs | Databases |
|---|---|
| derivatives/chlorfenac-ammonium | Alan Wood's Pesticides |
| Registry Numbers | Sources |
|---|---|
| CAS:53404-90-3 | ChemIDplus |
| CAS:53404-90-3 | Alan Wood's Pesticides |