EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C8H5Cl3O2 |
| Net Charge | 0 |
| Average Mass | 239.485 |
| Monoisotopic Mass | 237.93551 |
| SMILES | O=C(O)Cc1c(Cl)ccc(Cl)c1Cl |
| InChI | InChI=1S/C8H5Cl3O2/c9-5-1-2-6(10)8(11)4(5)3-7(12)13/h1-2H,3H2,(H,12,13) |
| InChIKey | QZXCCPZJCKEPSA-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| Biological Role: | synthetic auxin A synthetic compound exhibiting auxin activity. |
| Applications: | herbicide A substance used to destroy plant pests. agrochemical An agrochemical is a substance that is used in agriculture or horticulture. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| chlorfenac (CHEBI:82235) has role agrochemical (CHEBI:33286) |
| chlorfenac (CHEBI:82235) has role herbicide (CHEBI:24527) |
| chlorfenac (CHEBI:82235) has role synthetic auxin (CHEBI:26841) |
| chlorfenac (CHEBI:82235) is a phenylacetic acids (CHEBI:25978) |
| chlorfenac (CHEBI:82235) is a trichlorobenzene (CHEBI:27096) |
| chlorfenac (CHEBI:82235) is conjugate acid of chlorfenac(1−) (CHEBI:142831) |
| Incoming Relation(s) |
| chlorfenac(1−) (CHEBI:142831) is conjugate base of chlorfenac (CHEBI:82235) |
| IUPAC Name |
|---|
| (2,3,6-trichlorophenyl)acetic acid |
| Synonyms | Source |
|---|---|
| 2,3,6-TCA | ChemIDplus |
| 2,3,6-trichlorobenzeneacetic acid | ChemIDplus |
| 2,3,6-Trichlorphenylessigsaeure | ChemIDplus |
| chlorfénac | ChEBI |
| fenac | Alan Wood's Pesticides |
| Manual Xrefs | Databases |
|---|---|
| 1194 | PPDB |
| C19114 | KEGG COMPOUND |
| chlorfenac | Alan Wood's Pesticides |