EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C20H28N2O5S |
| Net Charge | 0 |
| Average Mass | 408.520 |
| Monoisotopic Mass | 408.17189 |
| SMILES | CCOc1ccccc1OCCN[C@@H](C)Cc1ccc(OC)c(S(N)(=O)=O)c1 |
| InChI | InChI=1S/C20H28N2O5S/c1-4-26-17-7-5-6-8-18(17)27-12-11-22-15(2)13-16-9-10-19(25-3)20(14-16)28(21,23)24/h5-10,14-15,22H,4,11-13H2,1-3H3,(H2,21,23,24)/t15-/m0/s1 |
| InChIKey | DRHKJLXJIQTDTD-HNNXBMFYSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| ent-tamsulosin (CHEBI:142548) is a 5-(2-{[2-(2-ethoxyphenoxy)ethyl]amino}propyl)-2-methoxybenzenesulfonamide (CHEBI:142546) |
| ent-tamsulosin (CHEBI:142548) is conjugate base of ent-tamsulosin(1+) (CHEBI:142549) |
| ent-tamsulosin (CHEBI:142548) is enantiomer of tamsulosin (CHEBI:9398) |
| Incoming Relation(s) |
| rac-tamsulosin (CHEBI:142552) has part ent-tamsulosin (CHEBI:142548) |
| ent-tamsulosin(1+) (CHEBI:142549) is conjugate acid of ent-tamsulosin (CHEBI:142548) |
| tamsulosin (CHEBI:9398) is enantiomer of ent-tamsulosin (CHEBI:142548) |
| Synonyms | Source |
|---|---|
| (S)-tamsulosin | ChemIDplus |
| (S)-(+)-tamsulosin | ChEBI |
| (+)-tamsulosin | ChEBI |
| (S)-5-(2-((2-(2-ethoxyphenoxy)ethyl)amino)propyl)-2-methoxybenzenesulfonamide | ChEBI |
| Registry Numbers | Sources |
|---|---|
| Reaxys:6896058 | Reaxys |
| CAS:106138-88-9 | ChemIDplus |
| Citations |
|---|