EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C20H28N2O5S |
| Net Charge | 0 |
| Average Mass | 408.520 |
| Monoisotopic Mass | 408.17189 |
| SMILES | CCOc1ccccc1OCCN[C@H](C)Cc1ccc(OC)c(S(N)(=O)=O)c1 |
| InChI | InChI=1S/C20H28N2O5S/c1-4-26-17-7-5-6-8-18(17)27-12-11-22-15(2)13-16-9-10-19(25-3)20(14-16)28(21,23)24/h5-10,14-15,22H,4,11-13H2,1-3H3,(H2,21,23,24)/t15-/m1/s1 |
| InChIKey | DRHKJLXJIQTDTD-OAHLLOKOSA-N |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Chemical Roles: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| Biological Role: | alpha-adrenergic antagonist An agent that binds to but does not activate α-adrenergic receptors thereby blocking the actions of endogenous or exogenous α-adrenergic agonists. α-Adrenergic antagonists are used in the treatment of hypertension, vasospasm, peripheral vascular disease, shock, and pheochromocytoma. |
| Applications: | vasodilator agent A drug used to cause dilation of the blood vessels. antineoplastic agent A substance that inhibits or prevents the proliferation of neoplasms. antiinfective agent A substance used in the prophylaxis or therapy of infectious diseases. alpha-adrenergic antagonist An agent that binds to but does not activate α-adrenergic receptors thereby blocking the actions of endogenous or exogenous α-adrenergic agonists. α-Adrenergic antagonists are used in the treatment of hypertension, vasospasm, peripheral vascular disease, shock, and pheochromocytoma. central nervous system stimulant Any drug that enhances the activity of the central nervous system. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| tamsulosin (CHEBI:9398) has role antiinfective agent (CHEBI:35441) |
| tamsulosin (CHEBI:9398) has role antineoplastic agent (CHEBI:35610) |
| tamsulosin (CHEBI:9398) has role vasodilator agent (CHEBI:35620) |
| tamsulosin (CHEBI:9398) has role α-adrenergic antagonist (CHEBI:37890) |
| tamsulosin (CHEBI:9398) is a 5-(2-{[2-(2-ethoxyphenoxy)ethyl]amino}propyl)-2-methoxybenzenesulfonamide (CHEBI:142546) |
| tamsulosin (CHEBI:9398) is a amphetamines (CHEBI:35338) |
| tamsulosin (CHEBI:9398) is a organic molecular entity (CHEBI:50860) |
| tamsulosin (CHEBI:9398) is conjugate base of tamsulosin(1+) (CHEBI:142544) |
| tamsulosin (CHEBI:9398) is enantiomer of ent-tamsulosin (CHEBI:142548) |
| Incoming Relation(s) |
| rac-tamsulosin (CHEBI:142552) has part tamsulosin (CHEBI:9398) |
| tamsulosin(1+) (CHEBI:142544) is conjugate acid of tamsulosin (CHEBI:9398) |
| ent-tamsulosin (CHEBI:142548) is enantiomer of tamsulosin (CHEBI:9398) |
| IUPAC Name |
|---|
| 5-[(2R)-2-{[2-(2-ethoxyphenoxy)ethyl]amino}propyl]-2-methoxybenzenesulfonamide |
| INNs | Source |
|---|---|
| tamsulosin | ChemIDplus |
| tamsulosina | ChemIDplus |
| tamsulosine | ChemIDplus |
| tamsulosinum | ChemIDplus |
| Synonyms | Source |
|---|---|
| HGP-0412 | ChEMBL |
| HIP-1402 | ChEMBL |
| HIP1402 | ChEMBL |
| (R)-5-(2-((2-(2-ethoxyphenoxy)ethyl)amino)propyl)-2-methoxybenzenesulfonamide | ChemIDplus |
| (R)-(−)-tamsulosin | ChEBI |
| Tamsulon | ChEMBL |
| Registry Numbers | Sources |
|---|---|
| Reaxys:6896059 | Reaxys |
| CAS:106133-20-4 | KEGG COMPOUND |
| CAS:106133-20-4 | ChemIDplus |
| Citations |
|---|