EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C20H28N2O5S |
| Net Charge | 0 |
| Average Mass | 408.520 |
| Monoisotopic Mass | 408.17189 |
| SMILES | CCOc1ccccc1OCCN[C@H](C)Cc1ccc(OC)c(S(N)(=O)=O)c1 |
| InChI | InChI=1S/C20H28N2O5S/c1-4-26-17-7-5-6-8-18(17)27-12-11-22-15(2)13-16-9-10-19(25-3)20(14-16)28(21,23)24/h5-10,14-15,22H,4,11-13H2,1-3H3,(H2,21,23,24)/t15-/m1/s1 |
| InChIKey | DRHKJLXJIQTDTD-OAHLLOKOSA-N |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| Biological Role: | alpha-adrenergic antagonist An agent that binds to but does not activate α-adrenergic receptors thereby blocking the actions of endogenous or exogenous α-adrenergic agonists. α-Adrenergic antagonists are used in the treatment of hypertension, vasospasm, peripheral vascular disease, shock, and pheochromocytoma. |
| Applications: | antineoplastic agent A substance that inhibits or prevents the proliferation of neoplasms. alpha-adrenergic antagonist An agent that binds to but does not activate α-adrenergic receptors thereby blocking the actions of endogenous or exogenous α-adrenergic agonists. α-Adrenergic antagonists are used in the treatment of hypertension, vasospasm, peripheral vascular disease, shock, and pheochromocytoma. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| tamsulosin (CHEBI:9398) has role antineoplastic agent (CHEBI:35610) |
| tamsulosin (CHEBI:9398) has role α-adrenergic antagonist (CHEBI:37890) |
| tamsulosin (CHEBI:9398) is a 5-(2-{[2-(2-ethoxyphenoxy)ethyl]amino}propyl)-2-methoxybenzenesulfonamide (CHEBI:142546) |
| tamsulosin (CHEBI:9398) is conjugate base of tamsulosin(1+) (CHEBI:142544) |
| tamsulosin (CHEBI:9398) is enantiomer of ent-tamsulosin (CHEBI:142548) |
| Incoming Relation(s) |
| rac-tamsulosin (CHEBI:142552) has part tamsulosin (CHEBI:9398) |
| tamsulosin(1+) (CHEBI:142544) is conjugate acid of tamsulosin (CHEBI:9398) |
| ent-tamsulosin (CHEBI:142548) is enantiomer of tamsulosin (CHEBI:9398) |
| IUPAC Name |
|---|
| 5-[(2R)-2-{[2-(2-ethoxyphenoxy)ethyl]amino}propyl]-2-methoxybenzenesulfonamide |
| INNs | Source |
|---|---|
| tamsulosin | ChemIDplus |
| tamsulosina | ChemIDplus |
| tamsulosine | ChemIDplus |
| tamsulosinum | ChemIDplus |
| Synonyms | Source |
|---|---|
| Tamsulosin | KEGG COMPOUND |
| (R)-5-(2-((2-(2-ethoxyphenoxy)ethyl)amino)propyl)-2-methoxybenzenesulfonamide | ChemIDplus |
| (−)-tamsulosin | ChEBI |
| (R)-(−)-tamsulosin | ChEBI |
| Registry Numbers | Sources |
|---|---|
| Reaxys:6896059 | Reaxys |
| CAS:106133-20-4 | KEGG COMPOUND |
| CAS:106133-20-4 | ChemIDplus |
| Citations |
|---|