EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C20H29N2O5S |
| Net Charge | +1 |
| Average Mass | 409.528 |
| Monoisotopic Mass | 409.17917 |
| SMILES | CCOc1ccccc1OCC[NH2+][C@@H](C)Cc1ccc(OC)c(S(N)(=O)=O)c1 |
| InChI | InChI=1S/C20H28N2O5S/c1-4-26-17-7-5-6-8-18(17)27-12-11-22-15(2)13-16-9-10-19(25-3)20(14-16)28(21,23)24/h5-10,14-15,22H,4,11-13H2,1-3H3,(H2,21,23,24)/p+1/t15-/m0/s1 |
| InChIKey | DRHKJLXJIQTDTD-HNNXBMFYSA-O |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| ent-tamsulosin(1+) (CHEBI:142549) is a secondary ammonium ion (CHEBI:137419) |
| ent-tamsulosin(1+) (CHEBI:142549) is conjugate acid of ent-tamsulosin (CHEBI:142548) |
| ent-tamsulosin(1+) (CHEBI:142549) is enantiomer of tamsulosin(1+) (CHEBI:142544) |
| Incoming Relation(s) |
| ent-tamsulosin hydrochloride (CHEBI:142550) has part ent-tamsulosin(1+) (CHEBI:142549) |
| ent-tamsulosin (CHEBI:142548) is conjugate base of ent-tamsulosin(1+) (CHEBI:142549) |
| tamsulosin(1+) (CHEBI:142544) is enantiomer of ent-tamsulosin(1+) (CHEBI:142549) |
| IUPAC Name |
|---|
| (2S)-N-[2-(2-ethoxyphenoxy)ethyl]-1-(4-methoxy-3-sulfamoylphenyl)propan-2-aminium |
| Synonyms | Source |
|---|---|
| (+)-tamsulosin(1+) | ChEBI |
| (S)-(+)-tamsulosin(1+) | ChEBI |
| (S)-5-(2-((2-(2-ethoxyphenoxy)ethyl)amino)propyl)-2-methoxybenzenesulfonamide(1+) | ChEBI |
| (S)-tamsulosin(1+) | ChEBI |