EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C20H18ClNO6 |
| Net Charge | 0 |
| Average Mass | 403.818 |
| Monoisotopic Mass | 403.08226 |
| SMILES | CC1Cc2c(Cl)cc(C(=O)N[C@@H](Cc3ccccc3)C(=O)O)c(O)c2C(=O)O1 |
| InChI | InChI=1S/C20H18ClNO6/c1-10-7-12-14(21)9-13(17(23)16(12)20(27)28-10)18(24)22-15(19(25)26)8-11-5-3-2-4-6-11/h2-6,9-10,15,23H,7-8H2,1H3,(H,22,24)(H,25,26)/t10?,15-/m0/s1 |
| InChIKey | RWQKHEORZBHNRI-WRXSAAJRSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| Biological Roles: | hapten Any substance capable of eliciting an immune response only when attached to a large carrier such as a protein. Examples include dinitrophenols; oligosaccharides; peptides; and heavy metals. mouse metabolite Any mammalian metabolite produced during a metabolic reaction in a mouse (Mus musculus). human metabolite Any mammalian metabolite produced during a metabolic reaction in humans (Homo sapiens). Saccharomyces cerevisiae metabolite Any fungal metabolite produced during a metabolic reaction in Baker's yeast (Saccharomyces cerevisiae ). Escherichia coli metabolite Any bacterial metabolite produced during a metabolic reaction in Escherichia coli. human metabolite Any mammalian metabolite produced during a metabolic reaction in humans (Homo sapiens). Saccharomyces cerevisiae metabolite Any fungal metabolite produced during a metabolic reaction in Baker's yeast (Saccharomyces cerevisiae ). Escherichia coli metabolite Any bacterial metabolite produced during a metabolic reaction in Escherichia coli. |
| Applications: | vulnerary A drug used in treating and healing of wounds. vulnerary A drug used in treating and healing of wounds. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| hapten OTAf (CHEBI:141331) has part ochratoxin A (CHEBI:7719) |
| hapten OTAf (CHEBI:141331) has role hapten (CHEBI:59174) |
| hapten OTAf (CHEBI:141331) is a (S)-(+)-allantoin (CHEBI:15678) |
| hapten OTAf (CHEBI:141331) is a N-acyl-L-phenylalanine (CHEBI:77673) |
| hapten OTAf (CHEBI:141331) is a diastereoisomeric mixture (CHEBI:60915) |
| hapten OTAf (CHEBI:141331) is a isochromanes (CHEBI:38762) |
| hapten OTAf (CHEBI:141331) is a monocarboxylic acid amide (CHEBI:29347) |
| hapten OTAf (CHEBI:141331) is a phenylalanine derivative (CHEBI:25985) |
| IUPAC Name |
|---|
| (2S)-2-[(5-chloro-8-hydroxy-3-methyl-1-oxo-3,4-dihydro-1H-2-benzopyran-7-carbonyl)amino]-3-phenylpropanoic acid |
| Synonyms | Source |
|---|---|
| (2S)-2-{[(5-chloro-8-hydroxy-3-methyl-1-oxo-3,4-dihydro-1H-isochromen-7-yl)carbonyl]amino}-3-phenylpropanoic acid | IUPAC |
| N-[(5-chloro-3,4-dihydro-8-hydroxy-3-methyl-1-oxo-1H-2-benzopyran-7-yl)carbonyl]-L-phenylalanine | ChEBI |
| Citations |
|---|