EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C4H6N4O3 |
| Net Charge | 0 |
| Average Mass | 158.117 |
| Monoisotopic Mass | 158.04399 |
| SMILES | NC(=O)N[C@H]1NC(=O)NC1=O |
| InChI | InChI=1S/C4H6N4O3/c5-3(10)6-1-2(9)8-4(11)7-1/h1H,(H3,5,6,10)(H2,7,8,9,11)/t1-/m0/s1 |
| InChIKey | POJWUDADGALRAB-SFOWXEAESA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Mus musculus (ncbitaxon:10090) | - | PubMed (19425150) | Source: BioModels - MODEL1507180067 |
| Roles Classification |
|---|
| Biological Roles: | mouse metabolite Any mammalian metabolite produced during a metabolic reaction in a mouse (Mus musculus). human metabolite Any mammalian metabolite produced during a metabolic reaction in humans (Homo sapiens). Escherichia coli metabolite Any bacterial metabolite produced during a metabolic reaction in Escherichia coli. Saccharomyces cerevisiae metabolite Any fungal metabolite produced during a metabolic reaction in Baker's yeast (Saccharomyces cerevisiae ). |
| Application: | vulnerary A drug used in treating and healing of wounds. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| (S)-(+)-allantoin (CHEBI:15678) has role mouse metabolite (CHEBI:75771) |
| (S)-(+)-allantoin (CHEBI:15678) is a allantoin (CHEBI:15676) |
| (S)-(+)-allantoin (CHEBI:15678) is enantiomer of (R)-(−)-allantoin (CHEBI:15677) |
| Incoming Relation(s) |
| hapten OTAf (CHEBI:141331) is a (S)-(+)-allantoin (CHEBI:15678) |
| (R)-(−)-allantoin (CHEBI:15677) is enantiomer of (S)-(+)-allantoin (CHEBI:15678) |
| IUPAC Name |
|---|
| N-[(4S)-2,5-dioxoimidazolidin-4-yl]urea |
| Synonyms | Source |
|---|---|
| (S)(+)-Allantoin | KEGG COMPOUND |
| (S)-Allantoin | KEGG COMPOUND |
| UniProt Name | Source |
|---|---|
| (S)-allantoin | UniProt |
| Manual Xrefs | Databases |
|---|---|
| C02350 | KEGG COMPOUND |
| 3AL | PDBeChem |
| S-ALLANTOIN | MetaCyc |
| Registry Numbers | Sources |
|---|---|
| Reaxys:83513 | Reaxys |