EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C3H6N2O3 |
| Net Charge | 0 |
| Average Mass | 118.092 |
| Monoisotopic Mass | 118.03784 |
| SMILES | NC(=O)NCC(=O)O |
| InChI | InChI=1S/C3H6N2O3/c4-3(8)5-1-2(6)7/h1H2,(H,6,7)(H3,4,5,8) |
| InChIKey | KZVRXPPUJQRGFN-UHFFFAOYSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Glycine max (ncbitaxon:3847) | |||
| seed (BTO:0001226) | PubMed (25369450) | ||
| seed (BTO:0001226) | MetaboLights (MTBLS118) | ||
| seed (BTO:0001226) | MetaboLights (MTBLS117) | ||
| Rattus norvegicus (ncbitaxon:10116) | - | PubMed (1282214) |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| Biological Roles: | xenobiotic metabolite Any metabolite produced by metabolism of a xenobiotic compound. rat metabolite Any mammalian metabolite produced during a metabolic reaction in rat (Rattus norvegicus). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| N-carbamoylglycine (CHEBI:133351) has functional parent glycine (CHEBI:15428) |
| N-carbamoylglycine (CHEBI:133351) has role rat metabolite (CHEBI:86264) |
| N-carbamoylglycine (CHEBI:133351) has role xenobiotic metabolite (CHEBI:76206) |
| N-carbamoylglycine (CHEBI:133351) is a N-acylglycine (CHEBI:16180) |
| N-carbamoylglycine (CHEBI:133351) is a monocarboxylic acid (CHEBI:25384) |
| N-carbamoylglycine (CHEBI:133351) is a ureas (CHEBI:47857) |
| N-carbamoylglycine (CHEBI:133351) is conjugate acid of N-carbamoylglycinate (CHEBI:233552) |
| Incoming Relation(s) |
| N-carbamoyl-D-phenylglycine (CHEBI:141249) has functional parent N-carbamoylglycine (CHEBI:133351) |
| N-carbamoylglycinate (CHEBI:233552) is conjugate base of N-carbamoylglycine (CHEBI:133351) |
| Synonyms | Source |
|---|---|
| Carbamoylglycine | ChemIDplus |
| Glycoluric acid | ChemIDplus |
| Hydantoic acid | ChemIDplus |
| N-Carbamylglycine | ChemIDplus |
| Manual Xrefs | Databases |
|---|---|
| 9626 | ChemSpider |
| N-CARBAMOYLGLYCINE | MetaCyc |
| Registry Numbers | Sources |
|---|---|
| Reaxys:1812022 | Reaxys |
| CAS:462-60-2 | ChemIDplus |
| Citations |
|---|